
CAS Number2782-57-2
Synonyms1,3-Dichloro-1,3,5-triazinane-2,4,6-trione; dichloroisocyanurate; Dichloro-s-triazinetrione; Troclosene; acl70; dichloro-1,3,5-triazinetrione; dichloro-isocyanuricaci; Dichloroisocyanuric acid; orced; isocyanuricdichloride; EINECS 220-487-5; ficlor71; hilite60; cdb60; dichlor; 1,3-Dichloro-s-triazine-2,4,6-trione; DICHLOROCYANURIC ACID
Molecular FormulaC3HCl2N3O3
Molecular Weight209.2
Density2.1±0.1 g/cm3
Boiling Point306.7ºC at 760mmHg
Melting Point225ºC
AppearanceWhite crystalline powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2782-57-2 |
| Catalog No. | 2A-9078035 |
| Chinese Name | 二氯异氰尿酸 |
| Synonyms | 1,3-Dichloro-1,3,5-triazinane-2,4,6-trione; dichloroisocyanurate; Dichloro-s-triazinetrione; Troclosene; acl70; dichloro-1,3,5-triazinetrione; dichloro-isocyanuricaci; Dichloroisocyanuric acid; orced; isocyanuricdichloride; EINECS 220-487-5; ficlor71; hilite60; cdb60; dichlor; 1,3-Dichloro-s-triazine-2,4,6-trione; DICHLOROCYANURIC ACID |
| Molecular Formula | C3HCl2N3O3 |
| Molecular Weight | 209.2 |
| Density | 2.1±0.1 g/cm3 |
| Boiling Point | 306.7ºC at 760mmHg |
| Melting Point | 225ºC |
| Appearance | White crystalline powder |
| Storage Condition | Store and keep sealed in a cool and dry place. |
| Packaging | II |
| HTC | 2933692100 |
| PubChem ID | 5797309 |
| SMILES | O=c1[nH]c(=O)n(Cl)c(=O)n1Cl |
| InChI | InChI=1S/C3HCl2N3O3.Na.2H2O/c4-7-1(9)6-2(10)8(5)3(7)11;;;/h(H,6,9,10);;2*1H2/q;+1;;/p-1 |
| InChI Key | CEJLBZWIKQJOAT-UHFFFAOYSA-N |
| Hazard Symbols | 5.1 |
| Tax Rebate | 9.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(4-Chloro-2-pyridinyl)-2,3-dihydro-2,2-diMethyl-4H-1,3-benzoxazin-4-one | 74405-00-8 | 2A-9078027 |
| 7,7-Diethyl-5-methoxy-1a,2,7,7a-tetrahydro-1H-1-aza-cyclopropa[b]naphthalene | 276881-51-7 | 2A-9078028 |
| 5-Chloro-2-indanone | 74444-81-8 | 2A-9078029 |
| Ethyl2-cyclobutylideneacetate | 27741-65-7 | 2A-9078032 |
| Methyl10-undecynoate | 2777-66-4 | 2A-9078033 |
| Ethyl4-(4,4-DiMethyl-2,6-dioxopiperidin-1-yl)benzoate | 279692-23-8 | 2A-9078042 |
| 1-(2-Bromophenyl)-cyclobutanecarbonitrile | 28049-62-9 | 2A-9078044 |
| 3-(1H-Imidazol-1-yl)-1-phenyl-1-propanone | 28918-16-3 | 2A-9078046 |
| 4,5-Dichloro-2-fluorobenzoicacid | 289039-49-2 | 2A-9078047 |
| 3-Chloro-5-iodobenzoicacid | 289039-25-4 | 2A-9078048 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA