
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 74444-81-8 |
| Catalog No. | 2A-9078029 |
| Chinese Name | 5-氯-2-茚满酮 |
| Synonyms | chloro-5 indanone-2; 5-Chloro-1,3-dihydro-2H-inden-2-one; 5-Chloro-2-Indanone; 5-chloro-1H-inden-2(3H)-one |
| Molecular Formula | C9H7ClO |
| Molecular Weight | 166.61 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 284.2±40.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2914700090 |
| PubChem ID | 37264080 |
| SMILES | O=C1Cc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C9H7ClO/c10-8-2-1-6-4-9(11)5-7(6)3-8/h1-3H,4-5H2 |
| InChI Key | MMMPPHUZDOMQDG-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Hydroxymethylcyclohexanol | 27583-43-3 | 2A-9078022 |
| 2-Formyl-6-methylbenzonitrile | 27613-37-2 | 2A-9078023 |
| 5-Bromo-2-nitrophenol | 27684-84-0 | 2A-9078025 |
| 3-(4-Chloro-2-pyridinyl)-2,3-dihydro-2,2-diMethyl-4H-1,3-benzoxazin-4-one | 74405-00-8 | 2A-9078027 |
| 7,7-Diethyl-5-methoxy-1a,2,7,7a-tetrahydro-1H-1-aza-cyclopropa[b]naphthalene | 276881-51-7 | 2A-9078028 |
| Ethyl2-cyclobutylideneacetate | 27741-65-7 | 2A-9078032 |
| Methyl10-undecynoate | 2777-66-4 | 2A-9078033 |
| 1,3-Dichloro-1,3,5-triazinane-2,4,6-trione | 2782-57-2 | 2A-9078035 |
| Ethyl4-(4,4-DiMethyl-2,6-dioxopiperidin-1-yl)benzoate | 279692-23-8 | 2A-9078042 |
| 1-(2-Bromophenyl)-cyclobutanecarbonitrile | 28049-62-9 | 2A-9078044 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA