![3-[(2-Chlorobenzyl)oxy]benzaldehyde structure, CAS 168084-94-4](/structures/80000/77990_1_168084_94_4.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 168084-94-4 |
| Catalog No. | 2A-9077990 |
| Chinese Name | 3-[(2-氯苄基)氧基]苯甲醛 |
| Synonyms | bb_sc-3595 |
| Molecular Formula | C14H11ClO2 |
| Molecular Weight | 276.71 |
| Density | 1.247g/cm3 |
| Boiling Point | 386.7ºC at 760 mmHg |
| Appearance | solid |
| HTC | 2913000090 |
| PubChem ID | 329819302 |
| MDL Number | MFCD03422404 |
| SMILES | Clc1c(cccc1)COc2c(cccc2C=O)OC |
| InChI | 1S/C15H13ClO3/c1-18-14-8-4-6-11(9-17)15(14)19-10-12-5-2-3-7-13(12)16/h2-9H,10H2,1H3 |
| InChI Key | LMTABTLVHQVPKW-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/77990_1_168084_94_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-(Methanesulfinyl)phenylboronicacid | 166386-48-7 | 2A-9077918 |
| 3-Bromo-2-hydroxy-5-nitrobenzaldehyde | 16789-84-7 | 2A-9077963 |
| 2,8-Diazaspiro[4.5]decane-8-carboxylicacid,1-oxo-,1,1-dimethylEthylester | 268550-48-7 | 2A-9077973 |
| 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate | 269410-00-6 | 2A-9077974 |
| 4-(Bromomethyl)phenol | 27079-92-1 | 2A-9077978 |
| 2-Cyanopyridine-5-boronicacidpinacolester | 741709-63-7 | 2A-9078006 |
| Methyl4-chloro-3-cyclohexene-1-carboxylate | 27705-05-1 | 2A-9078030 |
| 5-Bromo-2,3,4-trimethoxy-benzaldehyde | 28006-94-2 | 2A-9078043 |
| 3-Mehtoxypropionaldehyde | 2806-84-0 | 2A-9078045 |
| 5-Chloro-1H-indole-2-boronicacid | 282528-62-5 | 2A-9078058 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA