
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 27079-92-1 |
| Catalog No. | 2A-9077978 |
| Chinese Name | 对羟基苄基溴 |
| Synonyms | 4-bromomethylphenol; 4-(Bromomethyl)phenol; p-(Bromomethyl)phenol; p-hydroxybenzylbromide; 4-Hydroxybenzyl bromide |
| Molecular Formula | C7H7BrO |
| Molecular Weight | 187.034 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 269.9±15.0 °C at 760 mmHg |
| Storage Condition | -20°C |
| HTC | 2908199090 |
| PubChem ID | 8177227 |
| InChI | InChI=1S/C7H7BrO/c8-5-6-1-3-7(9)4-2-6/h1-4,9H,5H2 |
| InChI Key | MKNQNPYGAQGARI-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Tert-butyl-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenylcarbamate | 262444-42-8 | 2A-9077914 |
| 4-(Methanesulfinyl)phenylboronicacid | 166386-48-7 | 2A-9077918 |
| 3-Bromo-2-hydroxy-5-nitrobenzaldehyde | 16789-84-7 | 2A-9077963 |
| 2,8-Diazaspiro[4.5]decane-8-carboxylicacid,1-oxo-,1,1-dimethylEthylester | 268550-48-7 | 2A-9077973 |
| 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate | 269410-00-6 | 2A-9077974 |
| 3-[(2-Chlorobenzyl)oxy]benzaldehyde | 168084-94-4 | 2A-9077990 |
| 2-Cyanopyridine-5-boronicacidpinacolester | 741709-63-7 | 2A-9078006 |
| Methyl4-chloro-3-cyclohexene-1-carboxylate | 27705-05-1 | 2A-9078030 |
| 5-Bromo-2,3,4-trimethoxy-benzaldehyde | 28006-94-2 | 2A-9078043 |
| 3-Mehtoxypropionaldehyde | 2806-84-0 | 2A-9078045 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA