
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 26393-91-9 |
| Catalog No. | 2A-9077930 |
| Chinese Name | 1-(4-氟苯基)-2-甲基丙-1-酮 |
| Synonyms | 4′-Fluoroisobutyrophenone; 4'-fluoroisobutyrophenone; 4'-fluoro-2-methylpropiophenone |
| Molecular Formula | C10H11FO |
| Molecular Weight | 166.2 |
| Boiling Point | 95-97/7mm |
| Storage Condition | Keep receptacles sealed Place in a tight container |
| HTC | 2914700090 |
| PubChem ID | 3220456 |
| SMILES | CC(C)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H11FO/c1-7(2)10(12)8-3-5-9(11)6-4-8/h3-7H,1-2H3 |
| InChI Key | MHUVRVXSYXJUPK-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Bis(2-diphenylphosphinophenyl)ether | 166330-10-5 | 2A-9077912 |
| N-[[L-trans-3-(Ethoxycarbonyl)oxiran-2-yl]carbonyl]-L-leucyl-3-(p-hydroxyphenyl)Ethylamide | 262381-84-0 | 2A-9077913 |
| 3-(Difluoromethoxy)bromobenzene | 262587-05-3 | 2A-9077915 |
| Ethyl5-aminovalerate | 26342-05-2 | 2A-9077924 |
| N-Propylcyclopropanecarboxamide | 26389-59-3 | 2A-9077927 |
| 3-(5-Methyl-1,2,4-oxadiazol-3-yl)benzoicacid | 264264-32-6 | 2A-9077931 |
| H-Cys(Trt)-NH2 | 166737-85-5 | 2A-9077932 |
| Tert-butylcis-4-hydroxycyclohexylcarbamate | 167081-25-6 | 2A-9077934 |
| Ethylpicolinoylacetate | 26510-52-1 | 2A-9077935 |
| Tert-butyltrans-3-Hydroxymethylcyclobutylcarbamate | 167081-30-0 | 2A-9077937 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA