
CAS Number262587-05-3
SynonymsFYFOR CE; 1-Bromo-3-(difluoromethoxy)benzene; 3-Bromophenyl difluoromethyl ether; 3-(Difluoromethoxy)bromobenzene; MFCD00236233
Molecular FormulaC7H5BrF2O
Molecular Weight223.02
Density1.6±0.1 g/cm3
Boiling Point197.2±30.0 °C at 760 mmHg
Appearanceliquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 262587-05-3 |
| Catalog No. | 2A-9077915 |
| Chinese Name | 间二氟甲氧基溴苯 |
| Synonyms | FYFOR CE; 1-Bromo-3-(difluoromethoxy)benzene; 3-Bromophenyl difluoromethyl ether; 3-(Difluoromethoxy)bromobenzene; MFCD00236233 |
| Molecular Formula | C7H5BrF2O |
| Molecular Weight | 223.02 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 197.2±30.0 °C at 760 mmHg |
| Appearance | liquid |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2909309090 |
| PubChem ID | 3160458 |
| SMILES | FC(F)Oc1cccc(Br)c1 |
| InChI | InChI=1S/C7H5BrF2O/c8-5-2-1-3-6(4-5)11-7(9)10/h1-4,7H |
| InChI Key | NWBDGKNKAFGQQL-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Fluoro-3-methylbenzylamine | 261951-68-2 | 2A-9077900 |
| 3-Fluoro-4-Methylphenylaceticacid | 261951-74-0 | 2A-9077903 |
| 2-Methyl-4-(trifluoromethoxy)bromobenzene | 261951-96-6 | 2A-9077906 |
| Bis(2-diphenylphosphinophenyl)ether | 166330-10-5 | 2A-9077912 |
| N-[[L-trans-3-(Ethoxycarbonyl)oxiran-2-yl]carbonyl]-L-leucyl-3-(p-hydroxyphenyl)Ethylamide | 262381-84-0 | 2A-9077913 |
| Ethyl5-aminovalerate | 26342-05-2 | 2A-9077924 |
| N-Propylcyclopropanecarboxamide | 26389-59-3 | 2A-9077927 |
| 1-(4-Fluorophenyl)-2-Methylpropan-1-one | 26393-91-9 | 2A-9077930 |
| 3-(5-Methyl-1,2,4-oxadiazol-3-yl)benzoicacid | 264264-32-6 | 2A-9077931 |
| H-Cys(Trt)-NH2 | 166737-85-5 | 2A-9077932 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA