
CAS Number25173-68-6
SynonymsMFCD00016551; 3,4-Dichloro-benzenepropanoic acid; 3-(3,4-Dichlorophenyl)propanoic acid; F3099-6485; Benzenepropanoic acid,3,4-dichloro
Molecular FormulaC9H8Cl2O2
Molecular Weight219.07
Density1.4±0.1 g/cm3
Boiling Point339.2±27.0 °C at 760 mmHg
Melting Point97ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 25173-68-6 |
| Catalog No. | 2A-9077561 |
| Chinese Name | 3-(3,4-氯苯基)丙酸 |
| Synonyms | MFCD00016551; 3,4-Dichloro-benzenepropanoic acid; 3-(3,4-Dichlorophenyl)propanoic acid; F3099-6485; Benzenepropanoic acid,3,4-dichloro |
| Molecular Formula | C9H8Cl2O2 |
| Molecular Weight | 219.07 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 339.2±27.0 °C at 760 mmHg |
| Melting Point | 97ºC |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2916399090 |
| PubChem ID | 3185136 |
| SMILES | O=C(O)CCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl2O2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5H,2,4H2,(H,12,13) |
| InChI Key | NHYJRLYFKZYPMO-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl2-phenylpropanoate | 2510-99-8 | 2A-9077553 |
| 3-Methylisonicotinamide | 251101-36-7 | 2A-9077554 |
| 4-Bromo-3-chlorobenzoicacid | 25118-59-6 | 2A-9077556 |
| 2-Ethoxy-3-{4-[2-(4-methanesulfonyloxy-phenyl)-ethoxy]-phenyl}-propionicacid | 251565-85-2 | 2A-9077558 |
| Methylsulfonylaceticacid | 2516-97-4 | 2A-9077560 |
| 1-Bromo-2-(methylsulfonylmethyl)benzene | 25195-52-2 | 2A-9077563 |
| Etidronicacidmonohydrate | 25211-86-3 | 2A-9077569 |
| 3-Fluoro-4-(4-methyl-1H-imidazol-1-yl)benzenamine | 252340-70-8 | 2A-9077574 |
| 5-Hydroxy-4,4-DiMethylpentanenitrile | 25252-68-0 | 2A-9077578 |
| 3-Hydroxyphenylacetonitrile | 25263-44-9 | 2A-9077579 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA