
CAS Number132178-78-0
Synonyms1,5-dibromo-2,6-dihydroxynaphthalene; 1,5-Dibrom-naphthalin-2,6-diol; 1,5-dibromo-naphthalene-2,6-diol; 2,6-Naphthalenediol,1,5-dibromo; 1,5-Dibromo-2,6-naphthalenediol; 1.5-Dibrom-2.6-dihydroxy-naphthalin; 1,5-Dibromonaphthalene-2,6-diol
Molecular FormulaC10H6Br2O2
Molecular Weight317.96
Density2.081g/cm3
Boiling Point384.7ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 132178-78-0 |
| Catalog No. | 2A-9076811 |
| Chinese Name | 1,5-二溴萘-2,6-二醇 |
| Synonyms | 1,5-dibromo-2,6-dihydroxynaphthalene; 1,5-Dibrom-naphthalin-2,6-diol; 1,5-dibromo-naphthalene-2,6-diol; 2,6-Naphthalenediol,1,5-dibromo; 1,5-Dibromo-2,6-naphthalenediol; 1.5-Dibrom-2.6-dihydroxy-naphthalin; 1,5-Dibromonaphthalene-2,6-diol |
| Molecular Formula | C10H6Br2O2 |
| Molecular Weight | 317.96 |
| Density | 2.081g/cm3 |
| Boiling Point | 384.7ºC at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2908199090 |
| PubChem ID | 33133743 |
| SMILES | Oc1ccc2c(Br)c(O)ccc2c1Br |
| InChI | InChI=1S/C10H6Br2O2/c11-9-5-1-3-7(13)10(12)6(5)2-4-8(9)14/h1-4,13-14H |
| InChI Key | COJNHIANORGBGY-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromo-5-methoxy-benzenepropanoicacidethylester | 131819-11-9 | 2A-9076803 |
| 2-Isopropylquinazolin-4-ol | 13182-64-4 | 2A-9076804 |
| 4-Isopropoxybenzoicacid | 13205-46-4 | 2A-9076808 |
| 4-T-Butoxybenzoicacid | 13205-47-5 | 2A-9076809 |
| 5-Amino-2-nitrobenzoicacid | 132080-60-5 | 2A-9076810 |
| (5-Cyano-2-methyl-1H-indol-3-yl)-aceticacid | 13218-36-5 | 2A-9076812 |
| 2-Bromo-1-(4-bromophenyl)-ethanone | 132309-76-3 | 2A-9076817 |
| 2-(3-(Dimethylamino)phenyl)aceticacid | 132864-53-0 | 2A-9076821 |
| 6-(Trifluoromethoxy)-1H-benzimidazol-2-amine | 132877-27-1 | 2A-9076824 |
| 6-(Trifluoromethoxy)-1H-benzimidazol-2-aminehydrochloride | 132877-28-2 | 2A-9076825 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA