
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 131819-11-9 |
| Catalog No. | 2A-9076803 |
| Chinese Name | 2-溴-5-甲氧基-苯丙酸乙酯 |
| Molecular Formula | C12H15BrO3 |
| Molecular Weight | 233.02 |
| Density | 1.333g/cm3 |
| Boiling Point | 341.039ºC at 760 mmHg |
| Appearance | solid |
| HTC | 2918990090 |
| PubChem ID | 329771490 |
| MDL Number | MFCD07374968 |
| SMILES | COc1ncc(Br)cc1[N+]([O-])=O |
| InChI | 1S/C6H5BrN2O3/c1-12-6-5(9(10)11)2-4(7)3-8-6/h2-3H,1H3 |
| InChI Key | YRVHFGOAEVWBNS-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/76803_1_131819_11_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cyclopenta[c]pyrrol-4(1H)-one | 130658-09-2 | 2A-9076776 |
| (Tetrahydro-pyran-2-yl)aceticacid | 13103-40-7 | 2A-9076783 |
| C-Isoxazol-3-yl-methylaminehydrochloride | 131052-58-9 | 2A-9076785 |
| Syntheticcapsiate(Vanillylnonanoate) | 131119-10-3 | 2A-9076788 |
| 1-Bromo-3-isopropoxybenzene | 131738-73-3 | 2A-9076796 |
| 2-Isopropylquinazolin-4-ol | 13182-64-4 | 2A-9076804 |
| 4-Isopropoxybenzoicacid | 13205-46-4 | 2A-9076808 |
| 4-T-Butoxybenzoicacid | 13205-47-5 | 2A-9076809 |
| 5-Amino-2-nitrobenzoicacid | 132080-60-5 | 2A-9076810 |
| 1,5-Dibromonaphthalene-2,6-diol | 132178-78-0 | 2A-9076811 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA