
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13024-17-4 |
| Catalog No. | 2A-9076771 |
| Chinese Name | 甲基-(3-苯氧基苯基)胺 |
| Synonyms | N-methyl-3-phenoxy-aniline; METHYL-(3-PHENOXY-PHENYL)-AMINE; Benzenamine,N-methyl-3-phenoxy |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.24800 |
| Density | 1.11g/cm3 |
| Boiling Point | 326.1ºC at 760 mmHg |
| Appearance | solid |
| Storage Condition | room temperature, dry |
| HTC | 2922299090 |
| PubChem ID | 38568387 |
| MDL Number | MFCD13193921 |
| SMILES | NC1=CC(C2=NN=C(C)N2)=CC=C1.O |
| InChI | 1S/C9H10N4.H2O/c1-6-11-9(13-12-6)7-3-2-4-8(10)5-7;/h2-5H,10H2,1H3,(H,11,12,13);1H2 |
| InChI Key | WNNZJFVNICBRSG-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352116 |
| MSDS | msds/76771_1_13024_17_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-[4-(2-AminoEthyl)piperazin-1-yl]ethanone | 148716-35-2 | 2A-9076752 |
| Ivabradinehydrochloride | 148849-67-6 | 2A-9076753 |
| 7-Trifluoromethoxyisatin | 149125-30-4 | 2A-9076758 |
| 5-Pyridin-3-yl-2H-pyrazol-3-ylamine | 149246-87-7 | 2A-9076762 |
| HexafluoroacetylacetonatoNickel(ii)trihydrate | 14949-69-0 | 2A-9076770 |
| 3-Chlorophenylacetate | 13031-39-5 | 2A-9076772 |
| 5-Chloro-6-Methylpyrimidin-4-amine | 13040-89-6 | 2A-9076774 |
| Cyclopenta[c]pyrrol-4(1H)-one | 130658-09-2 | 2A-9076776 |
| (Tetrahydro-pyran-2-yl)aceticacid | 13103-40-7 | 2A-9076783 |
| C-Isoxazol-3-yl-methylaminehydrochloride | 131052-58-9 | 2A-9076785 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA