
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 177288-16-3 |
| Catalog No. | 2A-9076529 |
| Chinese Name | 3-氯苯甲酰甲醛水合物 |
| Synonyms | OR1625; 3-Chlorophenylglyoxal hydrate |
| Molecular Formula | C8H7ClO3 |
| Molecular Weight | 186.59200 |
| Boiling Point | 343.2ºC at 760mmHg |
| Storage Condition | 2-8°C |
| HTC | 2915900090 |
| PubChem ID | 38578709 |
| SMILES | O.O=CC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C8H5ClO2.H2O/c9-7-3-1-2-6(4-7)8(11)5-10;/h1-5H;1H2 |
| InChI Key | QDPIMXWMDQVBKT-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(2-Oxo-2-phenylEthyl)malononitrile | 14476-72-3 | 2A-9076505 |
| 3-Chloro-4-methoxybenzylalcohol | 14503-45-8 | 2A-9076508 |
| (2-Oxocyclohexyl)carbamicacidtert-butylester | 145106-47-4 | 2A-9076512 |
| Tert-butylN-(3-formylphenyl)carbamate | 176980-36-2 | 2A-9076518 |
| 2-Methyl-2-adamantylmethacrylate | 177080-67-0 | 2A-9076520 |
| 4-Bromo-2-chloro-5-fluorobenzoicacid | 177480-81-8 | 2A-9076536 |
| Tert-butyltrans-l-4-aminomethylcyclohexylcarbamate | 177583-27-6 | 2A-9076538 |
| Tert-Butyl5-(ethoxycarbonyl)pyrazin-2-ylcarbamate | 177759-80-7 | 2A-9076544 |
| 3-(1H-Imidazol-2-yl)-propionicacid | 178388-79-9 | 2A-9076554 |
| 1-(Pyridin-3-yl)cyclobutanamine | 1212058-02-0 | 2A-9076556 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA