
CAS Number177080-67-0
Synonyms(2-methyl-2-adamantyl) 2-methylprop-2-enoate; (1r,3r,5r,7r)-2-Methyladamantan-2-yl methacrylate; 2-Methyl-2-adamantyl Methacrylate; 2-Propenoic acid, 2-methyl-, 2-methyltricyclo[3.3.1.1]dec-2-yl ester; Methacrylic Acid 2-Methyl-2-adamantyl Ester; 2-Methyladamantan-2-yl methacrylate
Molecular FormulaC15H22O2
Molecular Weight234.34
Density1.1±0.1 g/cm3
Boiling Point301.3±11.0 °C at 760 mmHg
AppearanceLiquid;Colorless to Almost colorless clear liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 177080-67-0 |
| Catalog No. | 2A-9076520 |
| Chinese Name | 2-甲基丙烯酰氧基-2-甲基金刚烷 |
| Synonyms | (2-methyl-2-adamantyl) 2-methylprop-2-enoate; (1r,3r,5r,7r)-2-Methyladamantan-2-yl methacrylate; 2-Methyl-2-adamantyl Methacrylate; 2-Propenoic acid, 2-methyl-, 2-methyltricyclo[3.3.1.1]dec-2-yl ester; Methacrylic Acid 2-Methyl-2-adamantyl Ester; 2-Methyladamantan-2-yl methacrylate |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 301.3±11.0 °C at 760 mmHg |
| Appearance | Liquid;Colorless to Almost colorless clear liquid |
| Storage Condition | <0°C; avoid heating |
| HTC | 2916140000 |
| PubChem ID | 14798235 |
| MDL Number | MFCD04114354 |
| SMILES | C=C(C)C(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C15H22O2/c1-9(2)14(16)17-15(3)12-5-10-4-11(7-12)8-13(15)6-10/h10-13H,1,4-8H2,2-3H3 |
| InChI Key | FDYDISGSYGFRJM-UHFFFAOYSA-N |
| MSDS | msds/76520_1_177080_67_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 80.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Iodo-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one | 144750-83-4 | 2A-9076503 |
| 2-(2-Oxo-2-phenylEthyl)malononitrile | 14476-72-3 | 2A-9076505 |
| 3-Chloro-4-methoxybenzylalcohol | 14503-45-8 | 2A-9076508 |
| (2-Oxocyclohexyl)carbamicacidtert-butylester | 145106-47-4 | 2A-9076512 |
| Tert-butylN-(3-formylphenyl)carbamate | 176980-36-2 | 2A-9076518 |
| 3-Chlorophenylglyoxalhydrate | 177288-16-3 | 2A-9076529 |
| 4-Bromo-2-chloro-5-fluorobenzoicacid | 177480-81-8 | 2A-9076536 |
| Tert-butyltrans-l-4-aminomethylcyclohexylcarbamate | 177583-27-6 | 2A-9076538 |
| Tert-Butyl5-(ethoxycarbonyl)pyrazin-2-ylcarbamate | 177759-80-7 | 2A-9076544 |
| 3-(1H-Imidazol-2-yl)-propionicacid | 178388-79-9 | 2A-9076554 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA