
CAS Number14113-01-0
SynonymsEthyl hydrogen suberate; Octanedioic acid,ethyl; Ethyloctanedioic acid; 8-ethoxy-8-oxo-octanoic acid; monoethyl suberate; Suberic acid monoethyl ester; octanedioic acid mono ethyl ester
Molecular FormulaC10H18O4
Molecular Weight202.25
Density1.054 g/cm3
Boiling Point304.7ºC at 760 mmHg
Melting Point25-27ºC
Appearancesemi-solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14113-01-0 |
| Catalog No. | 2A-9076157 |
| Chinese Name | 辛二酸氢乙酯 |
| Synonyms | Ethyl hydrogen suberate; Octanedioic acid,ethyl; Ethyloctanedioic acid; 8-ethoxy-8-oxo-octanoic acid; monoethyl suberate; Suberic acid monoethyl ester; octanedioic acid mono ethyl ester |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 |
| Density | 1.054 g/cm3 |
| Boiling Point | 304.7ºC at 760 mmHg |
| Melting Point | 25-27ºC |
| Appearance | semi-solid |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2918990090 |
| PubChem ID | 10220533 |
| SMILES | CCOC(=O)CCCCCCC(=O)O |
| InChI | InChI=1S/C10H18O4/c1-2-14-10(13)8-6-4-3-5-7-9(11)12/h2-8H2,1H3,(H,11,12) |
| InChI Key | KCFVQEAPUOVXTH-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(Tetrahydro-pyran-2-yl)-1H-indazol-6-ylamine | 1053655-59-6 | 2A-0201666 |
| [4-(2-Morpholinoethoxy)phenyl]methylamine | 140836-69-7 | 2A-9076144 |
| 1,4-Dihydroxybutan-2-one | 140-86-3 | 2A-9076146 |
| 4-Fluoro-3-methoxybenzylbromide | 141080-73-1 | 2A-9076154 |
| 3-(2,3-Dimethoxyphenyl)propanoicacid | 10538-48-4 | 2A-9076156 |
| H-glu(obzl)-otbuhcl | 105590-97-4 | 2A-9076161 |
| (2-AminoEthyl)Ethylcarbamicacidtert-butylester | 105628-63-5 | 2A-9076165 |
| Argatroban | 141396-28-3 | 2A-9076166 |
| 7-Bromo-3,4-dihydro-2H-benzo[1,4]oxazine | 105679-22-9 | 2A-9076167 |
| 2-(2,3-Difluoro-6-nitrophenyl)aceticacid | 141428-47-9 | 2A-9076168 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA