CAS Number447-43-8
Synonyms(4-Fluorophenyl)(oxo)acetaldehyde hydrate; 2-(4-fluorophenyl)-2-oxoacetaldehyde hydrate; 1-(4-Fluor-phenyl)-2,2-dihydroxy-aethanon; 4-fluorophenylglyoxal monohydrate; 1-(4-fluorophenyl)-2,2-dihydroxyethanone; 4-fluorophenylglyoxal hydrate; MFCD01320770
Molecular FormulaC8H7O3F1
Molecular Weight170.14
Boiling Point115 °C
Melting Point80 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 447-43-8 |
| Catalog No. | 2A-9075256 |
| Chinese Name | 4-氟苯甲酰甲醛水合物 |
| Synonyms | (4-Fluorophenyl)(oxo)acetaldehyde hydrate; 2-(4-fluorophenyl)-2-oxoacetaldehyde hydrate; 1-(4-Fluor-phenyl)-2,2-dihydroxy-aethanon; 4-fluorophenylglyoxal monohydrate; 1-(4-fluorophenyl)-2,2-dihydroxyethanone; 4-fluorophenylglyoxal hydrate; MFCD01320770 |
| Molecular Formula | C8H7O3F1 |
| Molecular Weight | 170.14 |
| Boiling Point | 115 °C |
| Melting Point | 80 °C |
| Storage Condition | Store in a sealed container in a ventilated and dr |
| HTC | 2915900090 |
| PubChem ID | 3161235 |
| MDL Number | MFCD19982290 |
| SMILES | Fc1ccc(cc1)C(=O)C=O |
| InChI | InChI=1S/C8H5FO2/c9-7-3-1-6(2-4-7)8(11)5-10/h1-5H |
| InChI Key | InChIKey=IPWSCROFORAGJW-UHFFFAOYSA-N |
| MSDS | msds/75256_1_447_43_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Cyclohexylphenylglyoxalhydrate | 99433-89-3 | 2A-9075249 |
| 4-(5-bromothiophen-2-yl)thiazol-2-amine | 34801-14-4 | 2A-9075250 |
| 5,6-dihydro-2H-pyran-3-carboxylicacid | 100313-48-2 | 2A-9075252 |
| 4-Fluoro-2-Methoxyaniline | 450-91-9 | 2A-9075254 |
| 4-Fluoro-3-Methoxyphenylaceticacid | 78495-65-5 | 2A-9075255 |
| 4-Fluoropyridin-2-Ol | 96530-75-5 | 2A-9075257 |
| 4-Hydroxyphenylglyoxalhydrate | 197447-05-5 | 2A-9075261 |
| 4-Iodo-3-Methylphenol | 133921-27-4 | 2A-9075271 |
| 3-(3-Fluorophenyl)phenethylAlcohol | 840522-20-5 | 2A-9075278 |
| 4-Methoxy-2-Nitrobenzenesulfonylchloride | 18092-54-1 | 2A-9075281 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS