
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 78495-65-5 |
| Catalog No. | 2A-9075255 |
| Chinese Name | 2-氟-3,4-二甲氧基苯乙酸 |
| Synonyms | (4-Fluoro-3-methoxyphenyl)acetic acid; 4-Fluoro-3-methoxyphenylacetic acid |
| Molecular Formula | C10H11O4F1 |
| Molecular Weight | 214.19 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 317.1±27.0 °C at 760 mmHg |
| Melting Point | 103-107ºC |
| Storage Condition | room temperature |
| HTC | 2918990090 |
| PubChem ID | 8692963 |
| MDL Number | MFCD03411454 |
| SMILES | COc1ccc(CC(=O)O)c(F)c1OC |
| InChI | InChI=1S/C10H11FO4/c1-14-7-4-3-6(5-8(12)13)9(11)10(7)15-2/h3-4H,5H2,1-2H3,(H,12,13) |
| InChI Key | RAXDCPIEIZUGRH-UHFFFAOYSA-N |
| MSDS | msds/75255_1_78495_65_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(thiophen-2-yl)thiazol-2-amine | 28989-50-6 | 2A-9075246 |
| 4-Cyclohexylphenylglyoxalhydrate | 99433-89-3 | 2A-9075249 |
| 4-(5-bromothiophen-2-yl)thiazol-2-amine | 34801-14-4 | 2A-9075250 |
| 5,6-dihydro-2H-pyran-3-carboxylicacid | 100313-48-2 | 2A-9075252 |
| 4-Fluoro-2-Methoxyaniline | 450-91-9 | 2A-9075254 |
| 4-Fluorophenylglyoxalhydrate | 447-43-8 | 2A-9075256 |
| 4-Fluoropyridin-2-Ol | 96530-75-5 | 2A-9075257 |
| 4-Hydroxyphenylglyoxalhydrate | 197447-05-5 | 2A-9075261 |
| 4-Iodo-3-Methylphenol | 133921-27-4 | 2A-9075271 |
| 3-(3-Fluorophenyl)phenethylAlcohol | 840522-20-5 | 2A-9075278 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA