
CAS Number772-31-6
SynonymsCyclopropyl-(4-fluoro-phenyl)-methanone; MFCD00013728; EINECS 212-247-3; cyclopropyl-(4-fluorophenyl)methanone; Cyclopropyl(4-fluorophenyl)methanone; Cyclopropyl 4-fluorophenyl ketone
Molecular FormulaC10H9FO
Molecular Weight164.176
Purity97%
Density1.2±0.1 g/cm3
Boiling Point243.2±0.0 °C at 760 mmHg
Melting Point-15 °C
AppearanceTransparent very light yellow liquid
EINECS212-247-3
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 772-31-6 |
| Catalog No. | 2A-9007472 |
| Chinese Name | 4-氟苯基环丙基甲酮 |
| Synonyms | Cyclopropyl-(4-fluoro-phenyl)-methanone; MFCD00013728; EINECS 212-247-3; cyclopropyl-(4-fluorophenyl)methanone; Cyclopropyl(4-fluorophenyl)methanone; Cyclopropyl 4-fluorophenyl ketone |
| Molecular Formula | C10H9FO |
| Molecular Weight | 164.176 |
| Purity | 97 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 243.2±0.0 °C at 760 mmHg |
| Melting Point | -15 °C |
| Appearance | Transparent very light yellow liquid |
| Storage Condition | Keep container sealed and stored in a cool, dry pl |
| EINECS | 212-247-3 |
| HTC | 2914700090 |
| SMILES | O=C(c1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C10H9FO/c11-9-5-3-8(4-6-9)10(12)7-1-2-7/h3-7H,1-2H2 |
| InChI Key | MHKHJIJXMVHRAJ-UHFFFAOYSA-N |
| Safety Description | S24/25 |
| MSDS | msds/7472_1_772_31_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cyclohexylacetic acid | 5292-21-7 | 2A-9007459 |
| Cyclohexylmandelic acid methyl ester | 10399-13-0 | 2A-9007460 |
| Cyclooctane epoxide | 286-62-4 | 2A-9007463 |
| Cyclopentanone-2-carbonitrile | 2941-29-9 | 2A-9007464 |
| Cyclopropanecarbonitrile | 5500-21-0 | 2A-9007469 |
| Cyclopropyl bromide | 4333-56-6 | 2A-9007473 |
| Cyclopropyl methyl ketone | 765-43-5 | 2A-9007474 |
| Cyclopropylacetic acid | 5239-82-7 | 2A-9007476 |
| Cyclopropylacetonitrile | 6542-06-5 | 2A-9007477 |
| Cyclopropylacetylene | 6746-94-7 | 2A-9007478 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA