CAS Number10399-13-0
SynonymsMethyl 2-Cyclohexyl-2-hydroxyphenylacetate; Cyclohexyl 2-hydroxy-2-phenylpropanoate; EINECS 233-862-3; Benzeneacetic acid, α-hydroxy-α-methyl-, cyclohexyl ester; MFCD00269807; Methyl cyclohexylphenylglycolate; Benzeneacetic acid, α-cyclohexyl-α-hydroxy-, methyl ester; UNII:3B92G18V2B; Methyl cyclohexyl(hydroxy)phenylacetate
Molecular FormulaC15H20O3
Molecular Weight248.32
Purity97%
Density1.1±0.1 g/cm3
Boiling Point375.4±22.0 °C at 760 mmHg
Melting Point118-120 °C(lit.)
AppearanceLight yellow oily
EINECS233-862-3
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 10399-13-0 |
| Catalog No. | 2A-9007460 |
| Chinese Name | 2-环己基-2-羟基苯乙酸甲酯 |
| Synonyms | Methyl 2-Cyclohexyl-2-hydroxyphenylacetate; Cyclohexyl 2-hydroxy-2-phenylpropanoate; EINECS 233-862-3; Benzeneacetic acid, α-hydroxy-α-methyl-, cyclohexyl ester; MFCD00269807; Methyl cyclohexylphenylglycolate; Benzeneacetic acid, α-cyclohexyl-α-hydroxy-, methyl ester; UNII:3B92G18V2B; Methyl cyclohexyl(hydroxy)phenylacetate |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 |
| Purity | 97 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 375.4±22.0 °C at 760 mmHg |
| Melting Point | 118-120 °C(lit.) |
| Appearance | Light yellow oily |
| Storage Condition | Seal in a cool, dry place. |
| EINECS | 233-862-3 |
| HTC | 2918199090 |
| MDL Number | MFCD00269807 |
| SMILES | COC(=O)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C15H20O3/c1-18-14(16)15(17,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2,4-5,8-9,13,17H,3,6-7,10-11H2,1H3 |
| InChI Key | SPTZOODMHSABLY-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cyclobutanecarbonyl chloride | 5006-22-4 | 2A-9007450 |
| Cycloheptanol | 502-41-0 | 2A-9007454 |
| Cyclohepten-5-one | 2A-107455 | 2A-9007455 |
| Cyclohexyl 1-chloroethylcarbonate | 99464-83-2 | 2A-9007458 |
| Cyclohexylacetic acid | 5292-21-7 | 2A-9007459 |
| Cyclooctane epoxide | 286-62-4 | 2A-9007463 |
| Cyclopentanone-2-carbonitrile | 2941-29-9 | 2A-9007464 |
| Cyclopropanecarbonitrile | 5500-21-0 | 2A-9007469 |
| Cyclopropyl 4-fluorophenyl ketone | 772-31-6 | 2A-9007472 |
| Cyclopropyl bromide | 4333-56-6 | 2A-9007473 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS