
CAS Number52009-14-0
SynonymsPyruvic acid calcium; 2-oxo-propanoic acid calcium salt; CALCIUM PYRUVIC; MFCD00037199; EINECS 257-599-9; Caclium pyruvate; Calcim pyruvate; PYRUVIC ACID CALCIUM SALT; Calcium Pyruvate
Molecular FormulaC6H6O6Ca1
Molecular Weight214.19
Purity98%
Density1.031 g/mL at 25 °C
Boiling Point165ºC at 760 mmHg
Appearancewhite powder
EINECS257-599-9
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52009-14-0 |
| Catalog No. | 2A-9007358 |
| Chinese Name | 丙酮酸钙 |
| Synonyms | Pyruvic acid calcium; 2-oxo-propanoic acid calcium salt; CALCIUM PYRUVIC; MFCD00037199; EINECS 257-599-9; Caclium pyruvate; Calcim pyruvate; PYRUVIC ACID CALCIUM SALT; Calcium Pyruvate |
| Molecular Formula | C6H6O6Ca1 |
| Molecular Weight | 214.19 |
| Purity | 98 |
| Density | 1.031 g/mL at 25 °C |
| Boiling Point | 165ºC at 760 mmHg |
| Appearance | white powder |
| Water Solubility | Violent reaction |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| Packaging | II |
| EINECS | 257-599-9 |
| HTC | 2918300090 |
| MDL Number | MFCD00037199 |
| SMILES | [Ca++].CC(=O)C([O-])=O |
| InChI | InChI=1S/C3H4O3.Ca/c1-2(4)3(5)6;/h1H3,(H,5,6);/q;+2/p-1 |
| InChI Key | InChIKey=QJYMFPMPYYGIJD-UHFFFAOYSA-M |
| Hazard Symbols | 4.3 |
| MSDS | msds/7358_1_52009_14_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| DIBUTYL ETHER | 142-96-1 | 2A-9007351 |
| Butylpyridinium bromide | 874-80-6 | 2A-9007353 |
| Butylpyridinium chloride | 1124-64-7 | 2A-9007354 |
| Calcium halophosphate fluorescent powder | 2A-107355 | 2A-9007355 |
| Calcium lactate | 28305-25-1 | 2A-9007356 |
| Camphene | 79-92-5 | 2A-9007359 |
| Camphor gum | 76-22-2 | 2A-9007360 |
| Carbobenzoxy-L-threonine amide | 49705-98-8 | 2A-9007362 |
| Carbonic acid tert-butyl phthalimido ester | 15263-20-4 | 2A-9007363 |
| Cationic Red X-GRL | 2A-107364 | 2A-9007364 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA