
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 175277-95-9 |
| Catalog No. | 2A-9073499 |
| Chinese Name | 3-乙基-2-碘甲苯 |
| Synonyms | 1-ethyl-2-iodo-3-methylbenzene; MFCD00052855; 3-Ethyl-2-iodotoluene |
| Molecular Formula | C9H11I |
| Molecular Weight | 246.08800 |
| Density | 1.532g/cm3 |
| Boiling Point | 118-120ºC(15 torr) |
| Appearance | Transparent yellow to red-brown liquid |
| Storage Condition | Storage method: airtight, cool, dry place |
| HTC | 2903999090 |
| PubChem ID | 3154812 |
| SMILES | CCc1cccc(C)c1I |
| InChI | InChI=1S/C9H11I/c1-3-8-6-4-5-7(2)9(8)10/h4-6H,3H2,1-2H3 |
| InChI Key | PCSPENCTMKMGFE-UHFFFAOYSA-N |
| MSDS | msds/73499_1_175277_95_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| methyl5-chloro-2-methoxynicotinate | 82060-51-3 | 2A-9073487 |
| 4-methyl-3,4-dihydro-2H-benzo[b][1,4]oxazine-7-carboxylicacid | 532391-89-2 | 2A-9073488 |
| 1-(2-amino-4-methoxyphenyl)ethanone | 42465-53-2 | 2A-9073494 |
| 5-bromoisophthalicacid | 23351-91-9 | 2A-9073497 |
| 1,3-difluoro-2-methyl-4-nitrobenzene | 79562-49-5 | 2A-9073498 |
| 2-amino-3-iodo-4-methylbenzoicacid | 882679-23-4 | 2A-9073501 |
| 3-amino-4-methyl-2-nitrobenzoicacid | 37901-90-9 | 2A-9073505 |
| 5-Phenyl-2H-pyrazol-3-ylamine | 827-41-8 | 2A-9073509 |
| Biphenyl-2-carboxylicacid | 103863-14-5 | 2A-9073512 |
| 5-bromo-2-chlorophenol | 183802-98-4 | 2A-9073514 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA