
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 42465-53-2 |
| Catalog No. | 2A-9073494 |
| Chinese Name | 2'-氨基-4'-甲氧基苯乙酮 |
| Synonyms | MFCD04972112; 1-(2-Amino-4-methoxyphenyl)ethanone |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 327.3±22.0 °C at 760 mmHg |
| Appearance | yellow solid |
| Storage Condition | 2-8℃ |
| HTC | 2922509090 |
| PubChem ID | 15711635 |
| SMILES | COc1ccc(C(C)=O)c(N)c1 |
| InChI | InChI=1S/C9H11NO2/c1-6(11)8-4-3-7(12-2)5-9(8)10/h3-5H,10H2,1-2H3 |
| InChI Key | FOFUOGSRVUOROJ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| methyl3-chloroisonicotinate | 98273-79-1 | 2A-9073482 |
| 2,2,2-Trifluoro-1-pyridin-3-yl-ethylamine | 336105-46-5 | 2A-9073484 |
| 1-(6-Bromo-pyridin-3-yl)-ethanone | 139042-59-4 | 2A-9073486 |
| methyl5-chloro-2-methoxynicotinate | 82060-51-3 | 2A-9073487 |
| 4-methyl-3,4-dihydro-2H-benzo[b][1,4]oxazine-7-carboxylicacid | 532391-89-2 | 2A-9073488 |
| 5-bromoisophthalicacid | 23351-91-9 | 2A-9073497 |
| 1,3-difluoro-2-methyl-4-nitrobenzene | 79562-49-5 | 2A-9073498 |
| 1-ethyl-2-iodo-3-methylbenzene | 175277-95-9 | 2A-9073499 |
| 2-amino-3-iodo-4-methylbenzoicacid | 882679-23-4 | 2A-9073501 |
| 3-amino-4-methyl-2-nitrobenzoicacid | 37901-90-9 | 2A-9073505 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA