
CAS Number328-75-6
Synonyms3,5-bistrifluoromethylnitrobenzene; EINECS 206-336-6; 1-Nitro-3,5-bis-trifluormethyl-benzol; 3,5-di(trifluoromethyl)nitrobenzene; 3,5-Bis(trifluoromethyl)nitrobenzene; MFCD00000384; 1-Nitro-3,5-bis(trifluoromethyl)benzene; 1-nitro-3,5-bis-trifluoromethyl-benzene
Molecular Formula(CF3)2C6H3Br
Molecular Weight293.00
Purity97%
Density1.5±0.1 g/cm3
Boiling Point154 °C (lit.)
Melting Point−16 °C (lit.)
AppearanceTransparent colorless to light yellow liquid
EINECS206-334-5
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 328-75-6 |
| Catalog No. | 2A-9000733 |
| Chinese Name | 3,5-双(三氟甲基)硝基苯 |
| Synonyms | 3,5-bistrifluoromethylnitrobenzene; EINECS 206-336-6; 1-Nitro-3,5-bis-trifluormethyl-benzol; 3,5-di(trifluoromethyl)nitrobenzene; 3,5-Bis(trifluoromethyl)nitrobenzene; MFCD00000384; 1-Nitro-3,5-bis(trifluoromethyl)benzene; 1-nitro-3,5-bis-trifluoromethyl-benzene |
| Molecular Formula | (CF3)2C6H3Br |
| Molecular Weight | 293.00 |
| Purity | 97 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 154 °C (lit.) |
| Melting Point | −16 °C (lit.) |
| Appearance | Transparent colorless to light yellow liquid |
| Storage Condition | Room Temperature |
| Packaging | III |
| EINECS | 206-334-5 |
| HTC | 2904909090 |
| PubChem ID | 24857431 |
| MDL Number | MFCD00000381 |
| SMILES | FC(F)(F)c1cc(Br)cc(c1)C(F)(F)F |
| InChI | 1S/C8H3BrF6/c9-6-2-4(7(10,11)12)1-5(3-6)8(13,14)15/h1-3H |
| InChI Key | CSVCVIHEBDJTCJ-UHFFFAOYSA-N |
| Beilstein/REAXYS | 2123669 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | Xi |
| Risk Codes | R36/37/38 |
| Safety Description | S24/25 |
| MSDS | msds/733_1_328_75_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 1,1,2,3,3,3-Hexafluoropropyl trichloromethyl ether | 56860-83-4 | 2A-9000622 |
| 1,1-Cyclopropanedicarboxylic acid | 598-10-7 | 2A-9000630 |
| 1,2-Bis(trifluoromethyl)benzene | 433-95-4 | 2A-9000684 |
| 1,2-Dichloro-3,3,3-trifluoro-2-(trifluoromethyl)propane | 138690-25-2 | 2A-9000702 |
| 1,3-Bis(chloromethyl)-1,1,3,3-tetramethyldisiloxane | 2362-10-9 | 2A-9000731 |
| 1,3-Dimethyladamantan-5-carboxylic acid | 14670-94-1 | 2A-9000761 |
| 1,3-Dithiane-2-carboxylic acid ethyl ester | 20462-00-4 | 2A-9000768 |
| 1,4-Benzodioxan-2-carboxylic acid | 3663-80-7 | 2A-9000777 |
| 1,4-Benzodioxan-5-carboxylic acid | 4442-53-9 | 2A-9000778 |
| 1,4-Benzodioxan-6-carbaldehyde | 29668-44-8 | 2A-9000779 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA