
CAS Number2362-10-9
Synonyms1,3-Bis(chloroMethyl)tetraMethyldisiloxane; EINECS 219-109-1; MFCD00000877; 1,3-Bis(chloromethyl)-1,1,3,3-tetramethyldisiloxane
Molecular FormulaC6H16Cl2OSi2
Molecular Weight231.268
Purity97%
Density1.0±0.1 g/cm3
Boiling Point204.7±0.0 °C at 760 mmHg
Melting Point-90°C
AppearanceLiquid;Colorless to Almost colorless clear liquid
EINECS219-109-1
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2362-10-9 |
| Catalog No. | 2A-9000731 |
| Chinese Name | 1,3-双(氯甲基)四甲基二硅氧烷 |
| Synonyms | 1,3-Bis(chloroMethyl)tetraMethyldisiloxane; EINECS 219-109-1; MFCD00000877; 1,3-Bis(chloromethyl)-1,1,3,3-tetramethyldisiloxane |
| Molecular Formula | C6H16Cl2OSi2 |
| Molecular Weight | 231.268 |
| Purity | 97 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 204.7±0.0 °C at 760 mmHg |
| Melting Point | -90°C |
| Appearance | Liquid;Colorless to Almost colorless clear liquid |
| Water Solubility | Water solubility: insoluble |
| Storage Condition | Store in cold, dry conditions, in a ventilated are |
| EINECS | 219-109-1 |
| HTC | 2934999090 |
| UN(IATA) | UN 1993 |
| SMILES | C[Si](C)(CCl)O[Si](C)(C)CCl |
| InChI | InChI=1S/C6H16Cl2OSi2/c1-10(2,5-7)9-11(3,4)6-8/h5-6H2,1-4H3 |
| InChI Key | NBGGEWGFZUDQKZ-UHFFFAOYSA-N |
| Hazard Symbols | Xi |
| Risk Codes | R36/37/38 |
| Safety Description | S26;S36 |
| MSDS | msds/731_1_2362_10_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 1,1,2,3,3,3-Hexafluoropropyl difluoromethyl ether | 56860-85-6 | 2A-9000619 |
| 1,1,2,3,3,3-Hexafluoropropyl trichloromethyl ether | 56860-83-4 | 2A-9000622 |
| 1,1-Cyclopropanedicarboxylic acid | 598-10-7 | 2A-9000630 |
| 1,2-Bis(trifluoromethyl)benzene | 433-95-4 | 2A-9000684 |
| 1,2-Dichloro-3,3,3-trifluoro-2-(trifluoromethyl)propane | 138690-25-2 | 2A-9000702 |
| 1,3-Bis(trifluoromethyl)-5-nitrobenzene | 328-75-6 | 2A-9000733 |
| 1,3-Dimethyladamantan-5-carboxylic acid | 14670-94-1 | 2A-9000761 |
| 1,3-Dithiane-2-carboxylic acid ethyl ester | 20462-00-4 | 2A-9000768 |
| 1,4-Benzodioxan-2-carboxylic acid | 3663-80-7 | 2A-9000777 |
| 1,4-Benzodioxan-5-carboxylic acid | 4442-53-9 | 2A-9000778 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA