CAS Number90555-66-1
Synonyms(3-Ethoxyphenyl)boronic acid; MFCD00274219; 3-Ethoxyphenylboronic acid
Molecular FormulaC8H11BO3
Molecular Weight165.982
Density1.1±0.1 g/cm3
Boiling Point328.3±44.0 °C at 760 mmHg
Melting Point139-146 °C(lit.)
AppearanceWhite to light yellow crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 90555-66-1 |
| Catalog No. | 2A-9073025 |
| Chinese Name | 3-乙氧基苯硼酸 |
| Synonyms | (3-Ethoxyphenyl)boronic acid; MFCD00274219; 3-Ethoxyphenylboronic acid |
| Molecular Formula | C8H11BO3 |
| Molecular Weight | 165.982 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 328.3±44.0 °C at 760 mmHg |
| Melting Point | 139-146 °C(lit.) |
| Appearance | White to light yellow crystal powder |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Sealed, cool, dry place |
| HTC | 2931900090 |
| PubChem ID | 3209331 |
| SMILES | CCOc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C8H11BO3/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6,10-11H,2H2,1H3 |
| InChI Key | CHCWUTJYLUBETR-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2’-Cyano-1,1’-biphenyl-4-carboxaldehyde | 135689-93-9 | 2A-9073004 |
| 3-Chlorocarbonylphenylboronicacid | 332154-38-2 | 2A-9073021 |
| 2-Ethylthiophenylboronicacid | 362045-33-8 | 2A-9073022 |
| 2-Isopropylphenyboronicacid | 89787-12-2 | 2A-9073023 |
| 2-Phenoxyphenylboronicacid | 108238-09-1 | 2A-9073024 |
| 3-(2-Ethoxycarbonylethyl)phenylboronicacid | 913835-82-2 | 2A-9073026 |
| 3-Benzyloxyphenylboronicacid | 156682-54-1 | 2A-9073027 |
| 4-Chlorocarbonylphenylboronicacid | 332154-57-1 | 2A-9073028 |
| 4-Ethylthiophenylboronicacid | 145349-76-4 | 2A-9073029 |
| 4-Isopropoxyphenylboronicacid | 153624-46-5 | 2A-9073030 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS