
CAS Number108238-09-1
Synonyms2-Phenoxybenzeneboronic acid; (2-phenoxyphenyl)boronic acid; MFCD01001592
Molecular FormulaC12H11BO3
Molecular Weight214.02500
Density1.23g/cm3
Boiling Point369ºC at 760 mmHg
Melting Point104-108 °C(lit.)
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 108238-09-1 |
| Catalog No. | 2A-9073024 |
| Chinese Name | 2-苯氧基苯硼酸 |
| Synonyms | 2-Phenoxybenzeneboronic acid; (2-phenoxyphenyl)boronic acid; MFCD01001592 |
| Molecular Formula | C12H11BO3 |
| Molecular Weight | 214.02500 |
| Density | 1.23g/cm3 |
| Boiling Point | 369ºC at 760 mmHg |
| Melting Point | 104-108 °C(lit.) |
| Appearance | Solid;White to Almost white powder to crystal |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| PubChem ID | 3208891 |
| SMILES | OB(O)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C12H11BO3/c14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10/h1-9,14-15H |
| InChI Key | AVOWPOFIQZSVGV-UHFFFAOYSA-N |
| Transport Info | Product name: 2-phenoxybenzeneboronic acid (contains an indefinite amount of anhydride) |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-n-Butyl-1,3-diaza-spiro[4,4]non-1-en-4-onehydrochloride | 151257-01-1 | 2A-9073003 |
| 2’-Cyano-1,1’-biphenyl-4-carboxaldehyde | 135689-93-9 | 2A-9073004 |
| 3-Chlorocarbonylphenylboronicacid | 332154-38-2 | 2A-9073021 |
| 2-Ethylthiophenylboronicacid | 362045-33-8 | 2A-9073022 |
| 2-Isopropylphenyboronicacid | 89787-12-2 | 2A-9073023 |
| 3-Ethoxyphenylboronicacid | 90555-66-1 | 2A-9073025 |
| 3-(2-Ethoxycarbonylethyl)phenylboronicacid | 913835-82-2 | 2A-9073026 |
| 3-Benzyloxyphenylboronicacid | 156682-54-1 | 2A-9073027 |
| 4-Chlorocarbonylphenylboronicacid | 332154-57-1 | 2A-9073028 |
| 4-Ethylthiophenylboronicacid | 145349-76-4 | 2A-9073029 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA