
CAS Number108464-88-6
SynonymsMFCD00239360; 1,3-BIS(4-FLUOROBENZOYL)BENZENE; 1,3-Phenylenebis[(4-fluorophenyl)methanone]; [3-(4-fluorobenzoyl)phenyl]-(4-fluorophenyl)methanone
Molecular FormulaC21H18F2N4O2
Molecular Weight396.4
Density1.3±0.1 g/cm3
Boiling Point476.3±40.0 °C at 760 mmHg
Melting Point181-183ºC(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 108464-88-6 |
| Catalog No. | 2A-9072248 |
| Chinese Name | 1,3-双(4-氟苯甲酰)苯 |
| Synonyms | MFCD00239360; 1,3-BIS(4-FLUOROBENZOYL)BENZENE; 1,3-Phenylenebis[(4-fluorophenyl)methanone]; [3-(4-fluorobenzoyl)phenyl]-(4-fluorophenyl)methanone |
| Molecular Formula | C21H18F2N4O2 |
| Molecular Weight | 396.4 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 476.3±40.0 °C at 760 mmHg |
| Melting Point | 181-183ºC(lit.) |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2914700090 |
| PubChem ID | 5583941 |
| MDL Number | MFCD00091007 |
| SMILES | O=C(c1ccc(F)cc1)c1cccc(C(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H12F2O2/c21-17-8-4-13(5-9-17)19(23)15-2-1-3-16(12-15)20(24)14-6-10-18(22)11-7-14/h1-12H |
| InChI Key | PISLKPDKKIDMQT-UHFFFAOYSA-N |
| MSDS | msds/72248_1_108464_88_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzenamine,4,4'-[[1,1'-biphenyl]-2,5-diylbis(oxy)]bis- | 94148-67-1 | 2A-9072242 |
| Benzoylchloride,4,4'-oxybis- | 7158-32-9 | 2A-9072244 |
| 1-(1-trityl-1H-imidazol-4-yl)propane-1,3-diol | 426219-41-2 | 2A-9072245 |
| 3-hydroxy-1-(1-trityl-1H-imidazol-4-yl)propan-1-one | 426219-42-3 | 2A-9072246 |
| 1-(3-cyclopropylphenyl)ethanone | 408359-52-4 | 2A-9072247 |
| 1-(4-cyclopropylphenyl)ethanone | 6921-45-5 | 2A-9072249 |
| 4-cyclopropylbenzonitrile | 1126-27-8 | 2A-9072250 |
| PHENYLHYDROQUINONE | 1079-21-6 | 2A-9072251 |
| 1-cyclopropyl-4-nitrobenzene | 6921-44-4 | 2A-9072252 |
| 1-cyclopropyl-2-nitrobenzene | 10292-65-6 | 2A-9072253 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA