![Benzenamine,4,4'-[[1,1'-biphenyl]-2,5-diylbis(oxy)]bis- structure, CAS 94148-67-1](/structures/80000/72242_1_94148_67_1.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 94148-67-1 |
| Catalog No. | 2A-9072242 |
| Chinese Name | 2,5-双(4-氨基苯氧基)联苯 |
| Synonyms | 4,4'-[2,5-Biphenyldiylbis(oxy)]dianiline; papb; 4,4'-[biphenyl-2,5-diylbis(oxy)]dianiline |
| Molecular Formula | C26H18O2N2F6 |
| Molecular Weight | 504.43 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 567.6±50.0 °C at 760 mmHg |
| Appearance | beige cream |
| HTC | 2922299090 |
| PubChem ID | 10241254 |
| MDL Number | MFCD13185982 |
| SMILES | Nc1ccc(Oc2ccc(Oc3ccc(N)cc3)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H20N2O2/c25-18-6-10-20(11-7-18)27-22-14-15-24(28-21-12-8-19(26)9-13-21)23(16-22)17-4-2-1-3-5-17/h1-16H,25-26H2 |
| InChI Key | JWRLKLYWXKMAFL-UHFFFAOYSA-N |
| MSDS | msds/72242_1_94148_67_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-cyclopropyl-N,N-dimethylpyridin-2-amine | 1245645-43-5 | 2A-9072234 |
| 5-cyclopropylpyridin-2-amine | 893738-68-6 | 2A-9072235 |
| Ethanone,2-amino-1-(4-hydroxyphenyl)- | 77369-38-1 | 2A-9072236 |
| Ethanone,1-(3,4-dihydroxyphenyl)-2-[(1-methylethyl)amino]-,hydrochloride(1:1) | 16899-81-3 | 2A-9072237 |
| Cyclohexanol,2,6-bis(1,1-dimethylethyl)-4-methyl- | 163119-16-2 | 2A-9072241 |
| Benzoylchloride,4,4'-oxybis- | 7158-32-9 | 2A-9072244 |
| 1-(1-trityl-1H-imidazol-4-yl)propane-1,3-diol | 426219-41-2 | 2A-9072245 |
| 3-hydroxy-1-(1-trityl-1H-imidazol-4-yl)propan-1-one | 426219-42-3 | 2A-9072246 |
| 1-(3-cyclopropylphenyl)ethanone | 408359-52-4 | 2A-9072247 |
| Methanone,1,1'-(1,3-phenylene)bis[1-(4-fluorophenyl)- | 108464-88-6 | 2A-9072248 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA