
CAS Number35999-20-3
Synonyms3-Chloro-4'-methoxypropiophenone; 3-Chloro-1-(4-methoxyphenyl)propan-1-one; 3-chlor-1-(4-methoxyphenyl)propan-1-on; MFCD00236602; 3-Chloro-1-(4-methoxyphenyl)-1-propanone
Molecular FormulaC10H11ClO2
Molecular Weight198.651
Purity97%
Density1.1±0.1 g/cm3
Boiling Point330.0±22.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 35999-20-3 |
| Catalog No. | 2A-9007222 |
| Chinese Name | 3-氯-4'-甲氧基苯丙酮 |
| Synonyms | 3-Chloro-4'-methoxypropiophenone; 3-Chloro-1-(4-methoxyphenyl)propan-1-one; 3-chlor-1-(4-methoxyphenyl)propan-1-on; MFCD00236602; 3-Chloro-1-(4-methoxyphenyl)-1-propanone |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.651 |
| Purity | 97 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 330.0±22.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry |
| HTC | 2914700090 |
| MDL Number | MFCD00236602 |
| SMILES | COc1ccc(C(=O)CCCl)cc1 |
| InChI | InChI=1S/C10H11ClO2/c1-13-9-4-2-8(3-5-9)10(12)6-7-11/h2-5H,6-7H2,1H3 |
| InChI Key | FJBUZSAECLLZOL-UHFFFAOYSA-N |
| MSDS | msds/7222_1_35999_20_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzylpyridin-3-yl methylamine | 2A-107216 | 2A-9007216 |
| Benzylpyridin-4-yl methylamine | 73325-67-4 | 2A-9007217 |
| Benzylthiophen-2-ylmethylamine | 148883-56-1 | 2A-9007219 |
| Benzyltrimethylammonium tribromide | 111865-47-5 | 2A-9007220 |
| beta-Alaine | 107-95-9 | 2A-9007221 |
| beta-D-Glucose pentaacetate | 604-69-3 | 2A-9007223 |
| beta-D-Maltose octaacetate | 22352-19-8 | 2A-9007224 |
| beta-Histine dihdrochloride | 5579-84-0 | 2A-9007226 |
| beta-N,N-Diethylamino-L-Ala | 2A-107227 | 2A-9007227 |
| Biphenyl-2,2'-diacetonitrile | 93012-30-7 | 2A-9007230 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA