
CAS Number332-51-4
Synonyms2-[(4-fluorophenyl)thio]acetic acid; (4-fluoro-phenylsulfanyl)-acetic acid; F0917-0657; (4-Fluor-phenylmercapto)-essigsaeure; MFCD00219825; (4-Fluorophenylthio)Acetic Acid; (p-fluorophenylthio)acetic acid
Molecular FormulaC8H7FO2S
Molecular Weight186.20300
Density1.36 g/cm3
Boiling Point315.4ºC at 760 mmHg
Melting Point76-79°C
AppearanceOff-white to white crystalline solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 332-51-4 |
| Catalog No. | 2A-9072202 |
| Chinese Name | 2-[(4-氟苯基)硫代]乙酸 |
| Synonyms | 2-[(4-fluorophenyl)thio]acetic acid; (4-fluoro-phenylsulfanyl)-acetic acid; F0917-0657; (4-Fluor-phenylmercapto)-essigsaeure; MFCD00219825; (4-Fluorophenylthio)Acetic Acid; (p-fluorophenylthio)acetic acid |
| Molecular Formula | C8H7FO2S |
| Molecular Weight | 186.20300 |
| Density | 1.36 g/cm3 |
| Boiling Point | 315.4ºC at 760 mmHg |
| Melting Point | 76-79°C |
| Appearance | Off-white to white crystalline solid |
| Storage Condition | 2-8°C |
| HTC | 2930909090 |
| PubChem ID | 3161281 |
| SMILES | O=C(O)CSc1ccc(F)cc1 |
| InChI | InChI=1S/C8H7FO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11) |
| InChI Key | HQEROVXUKINLPI-UHFFFAOYSA-N |
| MSDS | msds/72202_1_332_51_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2930909090. other organo-sulfur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Bis(phenylsulfonyl)methane | 3406-02-8 | 2A-9072195 |
| 4'-BROMO-3-CHLOROPROPIOPHENONE | 31736-73-9 | 2A-9072196 |
| N-(2-FLUOROPHENYL)-1,2-DIAMINOBENZENE | 28898-03-5 | 2A-9072197 |
| 1-butoxy-3,5-difluorobenzene | 123843-64-1 | 2A-9072198 |
| 1-(4-fluorophenyl)-2-methylpropan-2-ol | 2928-17-8 | 2A-9072200 |
| 4-(4-fluorophenoxy)benzenamine | 36160-82-4 | 2A-9072203 |
| 4-chloro-2-ethoxy-1-fluorobenzene | 289039-34-5 | 2A-9072206 |
| TRICHLOROACETICANHYDRIDE | 4124-31-6 | 2A-9072207 |
| 1-(4-fluorophenyl)hydrazine | 371-14-2 | 2A-9072208 |
| 1-bromo-2-fluoro-4-(methoxymethyl)benzene | 162744-47-0 | 2A-9072210 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA