CAS Number31736-73-9
Synonyms1-(4-Bromophenyl)-3-chloropropan-1-one; 4'-Bromo-3-chloropropiophenone; 4-bromophenyl 2-chloroethyl ketone; 4′-Bromo-3-chloropropiophenone; MFCD00018979; 3-chloro-4'-bromopropiophenone; EINECS 250-784-5
Molecular FormulaC9H8BrClO
Molecular Weight247.52
Density1.499g/cm3
Boiling Point333.8ºC at 760mmHg
Melting Point54-59 °C(lit.)
AppearanceLight yellow to light brown crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 31736-73-9 |
| Catalog No. | 2A-9072196 |
| Chinese Name | 4'-溴-3-氯苯丙酮 |
| Synonyms | 1-(4-Bromophenyl)-3-chloropropan-1-one; 4'-Bromo-3-chloropropiophenone; 4-bromophenyl 2-chloroethyl ketone; 4′-Bromo-3-chloropropiophenone; MFCD00018979; 3-chloro-4'-bromopropiophenone; EINECS 250-784-5 |
| Molecular Formula | C9H8BrClO |
| Molecular Weight | 247.52 |
| Density | 1.499g/cm3 |
| Boiling Point | 333.8ºC at 760mmHg |
| Melting Point | 54-59 °C(lit.) |
| Appearance | Light yellow to light brown crystalline powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2914700090 |
| PubChem ID | 92876 |
| SMILES | O=C(CCCl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H8BrClO/c10-8-3-1-7(2-4-8)9(12)5-6-11/h1-4H,5-6H2 |
| InChI Key | SYWQQEVHZPPLNQ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| tert-butyl4-cyanophenylcarbamate | 143090-18-0 | 2A-9072189 |
| Ethanone,1-(4-hydroxyphenyl)-2-(methylamino)- | 21213-89-8 | 2A-9072190 |
| Dimethoxyethane | 94158-44-8 | 2A-9072192 |
| [Carboxymethyl-(2-hydroxy-5-methyl-benzyl)amino]aceticacid | 19938-33-1 | 2A-9072194 |
| Bis(phenylsulfonyl)methane | 3406-02-8 | 2A-9072195 |
| N-(2-FLUOROPHENYL)-1,2-DIAMINOBENZENE | 28898-03-5 | 2A-9072197 |
| 1-butoxy-3,5-difluorobenzene | 123843-64-1 | 2A-9072198 |
| 1-(4-fluorophenyl)-2-methylpropan-2-ol | 2928-17-8 | 2A-9072200 |
| 2-(4-fluorophenylthio)aceticacid | 332-51-4 | 2A-9072202 |
| 4-(4-fluorophenoxy)benzenamine | 36160-82-4 | 2A-9072203 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS