
CAS Number80992-93-4
SynonymsZ)-4(4-Trifluoromethylphenyl)-but-3-en-2-one; 1-[4-(Trifluoromethyl)phenyl]-1-buten-3-one; 4-[4-(Trifluoromethyl)phenyl]-3-buten-2-one; 4-[4-(trifluoromethyl)phenyl]but-3-en-2-one; (3Z)-4-[4-(Trifluoromethyl)phenyl]-3-buten-2-one; 4-trifluoromethylbenzylidene-acetone; p-Trifluoromethylbenzalacetone; 1-[4-(TRIFLUOROMETHYL)PHENYL]BUT-1-EN-3-ONE; 4-trifluoromethylbenzalacetone
Molecular FormulaC11H9O1F3
Molecular Weight214.19
Density1.206g/cm3
Boiling Point118ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 80992-93-4 |
| Catalog No. | 2A-9072201 |
| Chinese Name | 4-[4-(三氟甲基)苯基]-3-丁烯-2-酮 |
| Synonyms | Z)-4(4-Trifluoromethylphenyl)-but-3-en-2-one; 1-[4-(Trifluoromethyl)phenyl]-1-buten-3-one; 4-[4-(Trifluoromethyl)phenyl]-3-buten-2-one; 4-[4-(trifluoromethyl)phenyl]but-3-en-2-one; (3Z)-4-[4-(Trifluoromethyl)phenyl]-3-buten-2-one; 4-trifluoromethylbenzylidene-acetone; p-Trifluoromethylbenzalacetone; 1-[4-(TRIFLUOROMETHYL)PHENYL]BUT-1-EN-3-ONE; 4-trifluoromethylbenzalacetone |
| Molecular Formula | C11H9O1F3 |
| Molecular Weight | 214.19 |
| Density | 1.206g/cm3 |
| Boiling Point | 118ºC |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2914700090 |
| PubChem ID | 3214301 |
| MDL Number | MFCD00052848 |
| SMILES | CC(=O)C=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H9F3O/c1-8(15)2-3-9-4-6-10(7-5-9)11(12,13)14/h2-7H,1H3/b3-2- |
| InChI Key | PHVQEHOBDSECPV-NSCUHMNNSA-N |
| MSDS | msds/72201_1_80992_93_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,3,4,5-Tetrafluorophenylboronicacid | 179923-32-1 | 2A-9072172 |
| 2,3,4,6-Tetrafluorophenylboronicacid | 511295-00-4 | 2A-9072173 |
| 2,3,5,6-Tetrafluorophenylboronicacid | 511295-01-5 | 2A-9072175 |
| Sodium3,4-dihydro-2H-pyran-2-carboxylate | 16698-52-5 | 2A-9072187 |
| N-(4-(trifluoromethyl)phenyl)acetamide | 349-97-3 | 2A-9072193 |
| METHYL-(3-TRIFLUOROMETHYL-PHENYL)-AMINE | 2026-70-2 | 2A-9072209 |
| 1-(1-bromoethyl)-3-(trifluoromethyl)benzene | 68120-41-2 | 2A-9072211 |
| 3'-(TRIFLUOROMETHYL)ACETOPHENONEOXIME | 99705-50-7 | 2A-9072212 |
| 2-(Bromomethyl)-1-methoxy-4-nitrobenzene | 3913-23-3 | 2A-9072262 |
| 6-(benzyloxy)nicotinaldehyde | 635712-99-1 | 2A-9072285 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA