
CAS Number16698-52-5
Synonyms3,4-Dihydro-2 H-pyran-2-carboxylic acid,sodium salt; 3,4-Dihydro-2H-pyran-2-carbonsaeure,Natrium-Salz; sodium 3,4-dihydro-2H-pyran-2-carboxylate; sodium salt of 3,4-dihydro-2H-pyran-2-carboxylic acid
Molecular FormulaC6H8O3
Molecular Weight128.13
Density1.243g/cm3
Boiling Point278.3ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16698-52-5 |
| Catalog No. | 2A-9072187 |
| Chinese Name | 3,4-二氢吡喃2-羧酸钠 |
| Synonyms | 3,4-Dihydro-2 H-pyran-2-carboxylic acid,sodium salt; 3,4-Dihydro-2H-pyran-2-carbonsaeure,Natrium-Salz; sodium 3,4-dihydro-2H-pyran-2-carboxylate; sodium salt of 3,4-dihydro-2H-pyran-2-carboxylic acid |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 |
| Density | 1.243g/cm3 |
| Boiling Point | 278.3ºC at 760mmHg |
| HTC | 2932999099 |
| PubChem ID | 37599513 |
| MDL Number | MFCD19228699 |
| SMILES | O=C([O-])C1CCC=CO1.[Na+] |
| InChI | InChI=1S/C6H8O3.Na/c7-6(8)5-3-1-2-4-9-5;/h2,4-5H,1,3H2,(H,7,8); |
| InChI Key | QLCKHRQGBNMBPB-UHFFFAOYSA-M |
| MSDS | msds/72187_1_16698_52_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3,5-Difluoro-4-difluoromethoxyphenylboronicacid | 915401-97-7 | 2A-9072167 |
| (4'-Trifluoromethylbiphenyl-4-yl)methanol | 457889-46-2 | 2A-9072171 |
| 2,3,4,5-Tetrafluorophenylboronicacid | 179923-32-1 | 2A-9072172 |
| 2,3,4,6-Tetrafluorophenylboronicacid | 511295-00-4 | 2A-9072173 |
| 2,3,5,6-Tetrafluorophenylboronicacid | 511295-01-5 | 2A-9072175 |
| N-(4-(trifluoromethyl)phenyl)acetamide | 349-97-3 | 2A-9072193 |
| (Z)-4-(4-(trifluoromethyl)phenyl)but-3-en-2-one | 80992-93-4 | 2A-9072201 |
| METHYL-(3-TRIFLUOROMETHYL-PHENYL)-AMINE | 2026-70-2 | 2A-9072209 |
| 1-(1-bromoethyl)-3-(trifluoromethyl)benzene | 68120-41-2 | 2A-9072211 |
| 3'-(TRIFLUOROMETHYL)ACETOPHENONEOXIME | 99705-50-7 | 2A-9072212 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA