
CAS Number57351-00-5
Synonyms<6-Methoxy-1,2,3,4-tetrahydro-<2>naphthyl>-essigsaeure; 6-Methoxy-1,2,3,4-tetrahydro-2-naphthylacetic acid; 1,2,3,4-tetrahydro-6-methoxynaphthalene-2-acetic acid
Molecular FormulaC13H16O3
Molecular Weight220.26400
Density1.144g/cm3
Boiling Point404.002ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 57351-00-5 |
| Catalog No. | 2A-9071685 |
| Chinese Name | 2-(6-甲氧基-1,2,3,4-四氢萘-2-基)乙酸 |
| Synonyms | <6-Methoxy-1,2,3,4-tetrahydro-<2>naphthyl>-essigsaeure; 6-Methoxy-1,2,3,4-tetrahydro-2-naphthylacetic acid; 1,2,3,4-tetrahydro-6-methoxynaphthalene-2-acetic acid |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26400 |
| Density | 1.144g/cm3 |
| Boiling Point | 404.002ºC at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2918990090 |
| PubChem ID | 37421524 |
| SMILES | COc1ccc2c(c1)CCC(CC(=O)O)C2 |
| InChI | InChI=1S/C13H16O3/c1-16-12-5-4-10-6-9(7-13(14)15)2-3-11(10)8-12/h4-5,8-9H,2-3,6-7H2,1H3,(H,14,15) |
| InChI Key | HFCQYKCGYMWUAH-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| D-2,6-Difluorophenylalanine, | 266360-62-7 | 2A-9071661 |
| N-(3-Fluoro-phenyl)-2,2-dimethyl-propionamide | 81740-17-2 | 2A-9071662 |
| Cis-4-hydroxy-L-prolinemonohydrochloride | 441067-49-8 | 2A-9071668 |
| trans-4-Hydroxy-D-prolinehydrochloride | 142347-81-7 | 2A-9071669 |
| 2-Amino-5-bromo-4-pyrimidinol | 61937-71-1 | 2A-9071682 |
| 2-[3-Methyl-2-(methylimino)-4-oxo-1,3-thiazolan-5-yl]aceticacid | 41306-29-0 | 2A-9071688 |
| Ethyl2-(1-benzylpiperidin-4-ylidene)acetate | 40110-55-2 | 2A-9071689 |
| 2-Amino-2-indancarboxylicacid | 27473-62-7 | 2A-9071691 |
| 2-Chlorophenethylalcohol | 19819-95-5 | 2A-9071694 |
| 3-Cyanopropanoicacid | 16051-87-9 | 2A-9071698 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA