
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53111-20-9 |
| Catalog No. | 2A-9070802 |
| Chinese Name | 对茴香基二苯基膦 |
| Synonyms | 2-diphenylphosphanyl-1-methoxybenzene; 2-Methoxyphenyldiphenylphosphine; Ph2PC6H4-2-OCH3; MFCD00008361 |
| Molecular Formula | C19H17OP |
| Molecular Weight | 292.31100 |
| Boiling Point | 394.5ºC at 760 mmHg |
| Melting Point | 124-126ºC(lit.) |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2909309090 |
| PubChem ID | 6307946 |
| SMILES | COc1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17OP/c1-20-18-14-8-9-15-19(18)21(16-10-4-2-5-11-16)17-12-6-3-7-13-17/h2-15H,1H3 |
| InChI Key | GBXNVYBGIFEOEM-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352128 |
| MSDS | msds/70802_1_53111_20_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Di-m-toluoyl-L-tartaricacid | 65259-84-9 | 2A-9070790 |
| EpothiloneB | 152044-54-7 | 2A-9070797 |
| EpothiloneD | 189453-10-9 | 2A-9070798 |
| Tetraphenylporphyrin | 917-23-7 | 2A-9070800 |
| Zincmeso-tetraphenylporphine | 14074-80-7 | 2A-9070801 |
| Diphenyl(2-ethylthiophenyl)Phosphine | 104130-70-3 | 2A-9070803 |
| 1,1,1-Tris(mercaptomethyl)ethane | 39597-87-0 | 2A-9070804 |
| 1,2-Dithiane | 557-22-2 | 2A-9070805 |
| Diironhexacarbonyldisulfide | 58500-79-1 | 2A-9070806 |
| 1,2-diethylbenzene | 135-01-3 | 2A-9070813 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA