
CAS Number152044-54-7
SynonymsEpothilone B; (-)-Epothilone B; Epothilon B; EPO906,EpoB,Patupilone; EPO906; GNF-PF-193; UNII-UEC0H0URSE; Epothilone B (EPO906,Patupilone); Patupilone; EpoB
Molecular FormulaC27H41NO6S
Molecular Weight507.682
Density1.1±0.1 g/cm3
Boiling Point680.2±55.0 °C at 760 mmHg
Melting Point95-97ºC
Appearancewhite powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 152044-54-7 |
| Catalog No. | 2A-9070797 |
| Chinese Name | 埃博霉素B |
| Synonyms | Epothilone B; (-)-Epothilone B; Epothilon B; EPO906,EpoB,Patupilone; EPO906; GNF-PF-193; UNII-UEC0H0URSE; Epothilone B (EPO906,Patupilone); Patupilone; EpoB |
| Molecular Formula | C27H41NO6S |
| Molecular Weight | 507.682 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 680.2±55.0 °C at 760 mmHg |
| Melting Point | 95-97ºC |
| Appearance | white powder |
| Storage Condition | -20°C |
| Application | Epothilone B is a microtubule stabilizer with Ki of 0.71 μM. It acts by binding to αβ-tubulin heterodimer subunits, resulting in reduced αβ-tubulin dissociation. |
| HTC | 29419090 |
| PubChem ID | 14301 |
| SMILES | CC(=Cc1csc(C)n1)C1CC2OC2(C)CCCC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)O1 |
| InChI | InChI=1S/C27H41NO6S/c1-15-9-8-10-27(7)22(34-27)12-20(16(2)11-19-14-35-18(4)28-19)33-23(30)13-21(29)26(5,6)25(32)17(3)24(15)31/h11,14-15,17,20-22,24,29,31H,8-10,12-13H2,1-7H3/b16-11+/t15-,17+,20-,21-,22-,24-,27+/m0/s1 |
| InChI Key | QXRSDHAAWVKZLJ-PVYNADRNSA-N |
| Transport Info | Product Name: Epothilone B |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Asparticacid,N-[(phenylmethoxy)carbonyl]-,4-methylester | 3160-47-2 | 2A-9070786 |
| Di-o-toluoyl-L-tartaricacid | 65259-83-8 | 2A-9070787 |
| Di-o-toluoyl-D-tartaricacid | 391624-66-1 | 2A-9070788 |
| Di-m-toluoyl-D-tartaricacid | 391624-70-7 | 2A-9070789 |
| Di-m-toluoyl-L-tartaricacid | 65259-84-9 | 2A-9070790 |
| EpothiloneD | 189453-10-9 | 2A-9070798 |
| Tetraphenylporphyrin | 917-23-7 | 2A-9070800 |
| Zincmeso-tetraphenylporphine | 14074-80-7 | 2A-9070801 |
| Diphenyl(2-methoxyphenyl)Phosphine | 53111-20-9 | 2A-9070802 |
| Diphenyl(2-ethylthiophenyl)Phosphine | 104130-70-3 | 2A-9070803 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA