CAS Number194788-10-8
Synonyms3-Hydroxycyclobutanecarboxylic Acid; 3-cis-hydroxycyclobutanecarboxylic acid; Cyclobutanecarboxylic acid,3-hydroxy; 3-hydroxy cyclobutane carboxylic acid
Molecular FormulaC5H8O3
Molecular Weight116.12
Density1.4±0.1 g/cm3
Boiling Point290.1±33.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 194788-10-8 |
| Catalog No. | 2A-9070555 |
| Chinese Name | 3-羟基环丁基甲酸 |
| Synonyms | 3-Hydroxycyclobutanecarboxylic Acid; 3-cis-hydroxycyclobutanecarboxylic acid; Cyclobutanecarboxylic acid,3-hydroxy; 3-hydroxy cyclobutane carboxylic acid |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 290.1±33.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2918199090 |
| PubChem ID | 39846355 |
| MDL Number | MFCD08705859 |
| InChI | InChI=1S/C5H8O3/c6-4-1-3(2-4)5(7)8/h3-4,6H,1-2H2,(H,7,8) |
| InChI Key | ZSHGVMYLGGANKU-UHFFFAOYSA-N |
| MSDS | msds/70555_1_194788_10_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| methyl4-bromo-3,5-dimethoxybenzoate | 26050-64-6 | 2A-9070534 |
| (2-Amino-thiazol-5-yl)-aceticacid | 52454-66-7 | 2A-9070538 |
| 6-Methyl-4,5,6,7-tetrahydro-benzothiazol-2-ylamine | 7496-50-6 | 2A-9070545 |
| 5-methylthiazol-2-amine | 55502-89-1 | 2A-9070551 |
| 3-Hydroxy-cyclobutanecarboxylicacidbenzyleste | 480449-99-8 | 2A-0201605 |
| potassiumethylcarbonotrithioate | 35444-20-3 | 2A-9070557 |
| Methyl(1,2,3,4-tetra-O-acetyl-.alpha.-D-glucopyranosid)uronate | 5432-32-6 | 2A-9070560 |
| 5-nitroquinolin-2(1H)-one | 6938-27-8 | 2A-9070562 |
| 5-Isopropyl-[1,3,4]thiadiazol-2-ylamine | 27115-74-8 | 2A-9070563 |
| 6,7,8,9-Tetrahydro-5-thia-8-aza-benzocycloheptene | 58980-39-5 | 2A-9070566 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS