
CAS Number26050-64-6
Synonymsmethyl 3,5-dimethoxy-4-bromobenzoate; methyl 4-bromo-3,5-dimethoxybenzoate; 4-bromo-3,5-dimethoxybenzoic acid methyl ester; Benzoic acid, 4-bromo-3,5-dimethoxy-, methyl ester; 4-Brom-3,5-dimethoxy-benzoesaeure-methylester
Molecular FormulaC10H11BrO4
Molecular Weight275.1
Density1.4±0.1 g/cm3
Boiling Point351.0±37.0 °C at 760 mmHg
Melting Point119-120 °C
Appearancewhite to yellow solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 26050-64-6 |
| Catalog No. | 2A-9070534 |
| Chinese Name | 4-溴-3,5-二甲氧基苯甲酸甲酯 |
| Synonyms | methyl 3,5-dimethoxy-4-bromobenzoate; methyl 4-bromo-3,5-dimethoxybenzoate; 4-bromo-3,5-dimethoxybenzoic acid methyl ester; Benzoic acid, 4-bromo-3,5-dimethoxy-, methyl ester; 4-Brom-3,5-dimethoxy-benzoesaeure-methylester |
| Molecular Formula | C10H11BrO4 |
| Molecular Weight | 275.1 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 351.0±37.0 °C at 760 mmHg |
| Melting Point | 119-120 °C |
| Appearance | white to yellow solid |
| Storage Condition | room temperature, dry |
| PubChem ID | 3686968 |
| SMILES | COC(=O)c1cc(OC)c(Br)c(OC)c1 |
| InChI | InChI=1S/C10H11BrO4/c1-13-7-4-6(10(12)15-3)5-8(14-2)9(7)11/h4-5H,1-3H3 |
| InChI Key | DBPNSECLVZPWET-UHFFFAOYSA-N |
| Transport Info | Product name: Methyl 4-bromo-3,5-dimethoxybenzoate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Glycine,alanyl-,methylester(9CI) | 438002-26-7 | 2A-9070514 |
| N,N-dimethyl-2-(piperazin-1-yl)benzamideoxalate | 494782-69-3 | 2A-9070517 |
| 2-(pivalamido)aceticacid | 23891-96-5 | 2A-9070518 |
| 1-(isobutyryl)pyrrolidin-2-one | 92475-82-6 | 2A-9070522 |
| Ethanone,1-(2-pyrimidinyl) | 53342-27-1 | 2A-9070532 |
| (2-Amino-thiazol-5-yl)-aceticacid | 52454-66-7 | 2A-9070538 |
| 6-Methyl-4,5,6,7-tetrahydro-benzothiazol-2-ylamine | 7496-50-6 | 2A-9070545 |
| 5-methylthiazol-2-amine | 55502-89-1 | 2A-9070551 |
| 3-Hydroxy-cyclobutanecarboxylicacidbenzyleste | 480449-99-8 | 2A-0201605 |
| 3-hydroxycyclobutanecarboxylicacid | 194788-10-8 | 2A-9070555 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA