CAS Number14736-31-3
Synonymsethyl 4-oxochromen-2-carboxylate; 4-Oxo-4H-chromen-2-carbonsaeure-aethylester; Ethyl 4-oxo-4H-chromene-2-carboxylate; 4-oxo-4H-chromene-2-carboxylic acid ethyl ester; Ethyl 4-oxo-4H-1-benzopyran-2-carboxylate; 4H-1-Benzopyran-2-carboxylic acid, 4-oxo-, ethyl ester; Chromone-2-carboxylic acid ethyl ester; 2-ethyloxycarbonyl-chromone; 4H-1-BENZOPYRAN-2-CARBOXYLIC ACID,4-OXO-,ETHYL ESTER; ethyl chromone-2-carboxylate
Molecular FormulaC12H10O4
Molecular Weight218.21
Density1.3±0.1 g/cm3
Boiling Point325.0±42.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14736-31-3 |
| Catalog No. | 2A-9070202 |
| Chinese Name | 4-氧代-4H-1-苯并吡喃-2-甲酸乙酯 |
| Synonyms | ethyl 4-oxochromen-2-carboxylate; 4-Oxo-4H-chromen-2-carbonsaeure-aethylester; Ethyl 4-oxo-4H-chromene-2-carboxylate; 4-oxo-4H-chromene-2-carboxylic acid ethyl ester; Ethyl 4-oxo-4H-1-benzopyran-2-carboxylate; 4H-1-Benzopyran-2-carboxylic acid, 4-oxo-, ethyl ester; Chromone-2-carboxylic acid ethyl ester; 2-ethyloxycarbonyl-chromone; 4H-1-BENZOPYRAN-2-CARBOXYLIC ACID,4-OXO-,ETHYL ESTER; ethyl chromone-2-carboxylate |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 325.0±42.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2918300090 |
| PubChem ID | 3266799 |
| MDL Number | MFCD00250077 |
| SMILES | CCOC(=O)C1=CC(=O)c2ccccc2O1 |
| InChI | InChI=1S/C12H10O4/c1-2-15-12(14)11-7-9(13)8-5-3-4-6-10(8)16-11/h3-7H,2H2,1H3 |
| InChI Key | InChIKey=CJVFJZNWXDFXHF-UHFFFAOYSA-N |
| MSDS | msds/70202_1_14736_31_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| ethyl4-amino-2-(methylthio)thiazole-5-carboxylate | 39736-29-3 | 2A-9070191 |
| ethyl4-chloro-2,6-dimethylpyridine-3-carboxylate | 70271-80-6 | 2A-9070195 |
| ethyl4-chloropyridine-3-carboxylatehydrochloride | 174496-99-2 | 2A-9070197 |
| pyrimidine-2-carboxamidine | 45695-56-5 | 2A-9070198 |
| ethyl4-fluoro-1H-indole-2-carboxylate | 348-32-3 | 2A-9070199 |
| ethyl4-phenylthiazole-2-carboxylate | 31877-30-2 | 2A-9070203 |
| 4-(Hydroxymethyl)Pyrimidine | 33581-98-5 | 2A-9070204 |
| ethyl5-amino-2-methylthiazole-4-carboxylate | 31785-05-4 | 2A-9070206 |
| 2-Methylpyrimidine-5-carbaldehyde | 90905-33-2 | 2A-9070209 |
| ethyl5-iodo-1H-indole-2-carboxylate | 623918-49-0 | 2A-9070210 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS