
CAS Number348-32-3
SynonymsEthyl 4-fluoro-1H-indole-2-carboxylate; 4-Fluor-indol-2-carbonsaeure-aethylester; Ethyl-4-fluoroindole-2-carboxylate; 4-fluoro-indole-2-carboxylic acid ethyl ester; 4-fluoro-1H-indole-2-carboxylic acid ethyl ester; 1H-Indole-2-carboxylic acid, 4-fluoro-, ethyl ester
Molecular FormulaC11H10FNO2
Molecular Weight207.2
Density1.3±0.1 g/cm3
Boiling Point345.9±22.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 348-32-3 |
| Catalog No. | 2A-9070199 |
| Chinese Name | 4-氟吲哚-2-羧酸乙酯 |
| Synonyms | Ethyl 4-fluoro-1H-indole-2-carboxylate; 4-Fluor-indol-2-carbonsaeure-aethylester; Ethyl-4-fluoroindole-2-carboxylate; 4-fluoro-indole-2-carboxylic acid ethyl ester; 4-fluoro-1H-indole-2-carboxylic acid ethyl ester; 1H-Indole-2-carboxylic acid, 4-fluoro-, ethyl ester |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.2 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 345.9±22.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933990090 |
| PubChem ID | 38457968 |
| SMILES | CCOC(=O)c1cc2c(F)cccc2[nH]1 |
| InChI | InChI=1S/C11H10FNO2/c1-2-15-11(14)10-6-7-8(12)4-3-5-9(7)13-10/h3-6,13H,2H2,1H3 |
| InChI Key | ODEXIEZAUJDKKO-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5-bromo-2-methoxy-3-nitropyridine | 152684-30-5 | 2A-9070189 |
| ethyl4-amino-2-(methylthio)thiazole-5-carboxylate | 39736-29-3 | 2A-9070191 |
| ethyl4-chloro-2,6-dimethylpyridine-3-carboxylate | 70271-80-6 | 2A-9070195 |
| ethyl4-chloropyridine-3-carboxylatehydrochloride | 174496-99-2 | 2A-9070197 |
| pyrimidine-2-carboxamidine | 45695-56-5 | 2A-9070198 |
| ethyl4-oxo-4H-chromene-2-carboxylate | 14736-31-3 | 2A-9070202 |
| ethyl4-phenylthiazole-2-carboxylate | 31877-30-2 | 2A-9070203 |
| 4-(Hydroxymethyl)Pyrimidine | 33581-98-5 | 2A-9070204 |
| ethyl5-amino-2-methylthiazole-4-carboxylate | 31785-05-4 | 2A-9070206 |
| 2-Methylpyrimidine-5-carbaldehyde | 90905-33-2 | 2A-9070209 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA