
CAS Number194240-75-0
Synonyms2-(4-Chloro-2-fluorophenyl)acetic acid; 4-Chloro-2-fluorobenzeneacetic acid; QV1R DG BF; 4-Chloro-2-fluorophenylacetic acid; (4-Chloro-2-fluorophenyl)acetic acid; MFCD03095402
Molecular FormulaC8H6ClFO2
Molecular Weight188.583
Density1.4±0.1 g/cm3
Boiling Point287.3±25.0 °C at 760 mmHg
Melting Point113-115°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 194240-75-0 |
| Catalog No. | 2A-9069678 |
| Chinese Name | 4-氯-2-氟苯乙酸 |
| Synonyms | 2-(4-Chloro-2-fluorophenyl)acetic acid; 4-Chloro-2-fluorobenzeneacetic acid; QV1R DG BF; 4-Chloro-2-fluorophenylacetic acid; (4-Chloro-2-fluorophenyl)acetic acid; MFCD03095402 |
| Molecular Formula | C8H6ClFO2 |
| Molecular Weight | 188.583 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 287.3±25.0 °C at 760 mmHg |
| Melting Point | 113-115°C |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2916399090 |
| SMILES | O=C(O)Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C8H6ClFO2/c9-6-2-1-5(3-8(11)12)7(10)4-6/h1-2,4H,3H2,(H,11,12) |
| InChI Key | WKAZXGAJEGPUAY-UHFFFAOYSA-N |
| MSDS | msds/69678_1_194240_75_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-5-fluorophenylaceticacid | 177985-33-0 | 2A-9069669 |
| 3-Chloro-2-fluorophenylacetonitrile | 261762-98-5 | 2A-9069672 |
| 2-Bromo-1-chloro-4-(trifluoromethoxy)benzene | 468075-00-5 | 2A-9069673 |
| 3-Chloro-5-fluorophenylaceticacid | 202001-00-1 | 2A-9069675 |
| 2-chloroquinoxalin-6-amine | 112928-27-5 | 2A-9069677 |
| 2,3-Difluoro-4-bromonitrobenzene | 1003708-24-4 | 2A-9069680 |
| 5-Chloro-2-fluorophenylacetonitrile | 75279-54-8 | 2A-9069682 |
| 2-cycloheptylaceticacid | 4401-20-1 | 2A-9069684 |
| Propylamine,2-ethoxy- | 88183-49-7 | 2A-9069687 |
| 2-ethylbenzoicacid | 612-19-1 | 2A-9069689 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA