
CAS Number177985-33-0
Synonyms2-Chloro-5-fluorophenylacetic acid; QV1R BG EF; 2-Chloro-5-fluorobenzeneacetic acid; (2-Chloro-5-fluorophenyl)acetic acid; 2-(2-Chloro-5-fluorophenyl)acetic acid; MFCD01016155
Molecular FormulaC8H6ClFO2
Molecular Weight188.583
Density1.4±0.1 g/cm3
Boiling Point289.3±25.0 °C at 760 mmHg
Melting Point114-115ºC
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 177985-33-0 |
| Catalog No. | 2A-9069669 |
| Chinese Name | 2-氯-5-氟苯乙酸 |
| Synonyms | 2-Chloro-5-fluorophenylacetic acid; QV1R BG EF; 2-Chloro-5-fluorobenzeneacetic acid; (2-Chloro-5-fluorophenyl)acetic acid; 2-(2-Chloro-5-fluorophenyl)acetic acid; MFCD01016155 |
| Molecular Formula | C8H6ClFO2 |
| Molecular Weight | 188.583 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 289.3±25.0 °C at 760 mmHg |
| Melting Point | 114-115ºC |
| Appearance | solid |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2916399090 |
| SMILES | O=C(O)Cc1cc(F)ccc1Cl |
| InChI | InChI=1S/C8H6ClFO2/c9-7-2-1-6(10)3-5(7)4-8(11)12/h1-3H,4H2,(H,11,12) |
| InChI Key | VFUKAVLGRHSSPG-UHFFFAOYSA-N |
| MSDS | msds/69669_1_177985_33_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-chloro-7,8-dihydropteridin-6(5H)-one | 875231-98-4 | 2A-9069664 |
| 2-chloro-8-methyl-7,8-dihydropteridin-6(5H)-one | 944580-73-8 | 2A-9069665 |
| 2-Bromo-4-(trifluormethyl)phenylaceticacid | 518070-15-0 | 2A-9069666 |
| 2-Chloro-3-fluorobromobenzene | 883499-24-9 | 2A-9069667 |
| 2-chlorobenzamidinehydrochloride | 45743-05-3 | 2A-9069668 |
| 3-Chloro-2-fluorophenylacetonitrile | 261762-98-5 | 2A-9069672 |
| 2-Bromo-1-chloro-4-(trifluoromethoxy)benzene | 468075-00-5 | 2A-9069673 |
| 3-Chloro-5-fluorophenylaceticacid | 202001-00-1 | 2A-9069675 |
| 2-chloroquinoxalin-6-amine | 112928-27-5 | 2A-9069677 |
| 4-Chloro-2-fluorophenylaceticacid | 194240-75-0 | 2A-9069678 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA