
CAS Number129931-45-9
SynonymsQVR CG BF EXFFF; 3-Chloro-2-fluoro-5-(trifluoromethyl)benzoic acid; MFCD01631509; 5-Chloro-α,α,α,6-tetrafluoro-m-toluic acid
Molecular FormulaC8H3O2Cl1F4
Molecular Weight242.56
Density1.6±0.1 g/cm3
Boiling Point254.9±40.0 °C at 760 mmHg
Melting Point89-91°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 129931-45-9 |
| Catalog No. | 2A-9069387 |
| Chinese Name | 3-氯-2-氟-5-(三氟甲基)苯甲酸 |
| Synonyms | QVR CG BF EXFFF; 3-Chloro-2-fluoro-5-(trifluoromethyl)benzoic acid; MFCD01631509; 5-Chloro-α,α,α,6-tetrafluoro-m-toluic acid |
| Molecular Formula | C8H3O2Cl1F4 |
| Molecular Weight | 242.56 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 254.9±40.0 °C at 760 mmHg |
| Melting Point | 89-91°C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2916399090 |
| MDL Number | MFCD01631509 |
| SMILES | O=C(O)c1cc(C(F)(F)F)cc(Cl)c1F |
| InChI | InChI=1S/C8H3ClF4O2/c9-5-2-3(8(11,12)13)1-4(6(5)10)7(14)15/h1-2H,(H,14,15)/p-1 |
| InChI Key | UINXNXRHKMRASA-UHFFFAOYSA-N |
| MSDS | msds/69387_1_129931_45_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 1H-indole-7-carbohydrazide | 321309-24-4 | 2A-9069367 |
| 2,6-Bis(trifluoromethyl)benzoicacid | 24821-22-5 | 2A-9069370 |
| Methyl3,5-bis(trifluoromethyl)benzoate | 26107-80-2 | 2A-9069371 |
| 2-Fluoro-6-(trifluoromethyl)benzophenone | 208173-18-6 | 2A-9069374 |
| 2-Bromo-5-(trifluoromethyl)benzoicacid | 1483-56-3 | 2A-9069376 |
| 1-methyl-1H-indazol-5-yl-5-boronicacid | 590418-08-9 | 2A-9069394 |
| 1-methyl-1H-indazol-7-yl-7-boronicacid | 1001907-59-0 | 2A-9069397 |
| 3-Fluoro-4-(trifluoromethyl)benzophenone | 243128-47-4 | 2A-9069400 |
| 2,6-Bis(trifluoromethyl)aniline | 313-13-3 | 2A-9069407 |
| 3,5-Bis(trifluoromethyl)-4-chloroaniline | 948014-37-7 | 2A-9069410 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA