
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 208173-18-6 |
| Catalog No. | 2A-9069374 |
| Chinese Name | 2-氟-6-(三氟甲基)苯甲酮 |
| Synonyms | 2-fluoro-6-(trifluoromethyl)benzophenone; [2-Fluoro-6-(trifluoromethyl)phenyl](phenyl)methanone |
| Molecular Formula | C14H8O1F4 |
| Molecular Weight | 268.21 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 355.2±42.0 °C at 760 mmHg |
| Appearance | solid |
| Storage Condition | room temperature, inert gas |
| HTC | 2914700090 |
| MDL Number | MFCD00061255 |
| SMILES | O=C(c1ccccc1)c1c(F)cccc1C(F)(F)F |
| InChI Key | GZERPYCCZRGZNF-UHFFFAOYSA-N |
| MSDS | msds/69374_1_208173_18_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 1H-indole-4-carbohydrazide | 885272-22-0 | 2A-9069361 |
| 3-Amino-4-(trifluoromethyl)benzoicacid | 125483-00-3 | 2A-9069364 |
| 1H-indole-7-carbohydrazide | 321309-24-4 | 2A-9069367 |
| 2,6-Bis(trifluoromethyl)benzoicacid | 24821-22-5 | 2A-9069370 |
| Methyl3,5-bis(trifluoromethyl)benzoate | 26107-80-2 | 2A-9069371 |
| 2-Bromo-5-(trifluoromethyl)benzoicacid | 1483-56-3 | 2A-9069376 |
| 3-Chloro-2-fluoro-5-(trifluoromethyl)benzoicacid | 129931-45-9 | 2A-9069387 |
| 1-methyl-1H-indazol-5-yl-5-boronicacid | 590418-08-9 | 2A-9069394 |
| 1-methyl-1H-indazol-7-yl-7-boronicacid | 1001907-59-0 | 2A-9069397 |
| 3-Fluoro-4-(trifluoromethyl)benzophenone | 243128-47-4 | 2A-9069400 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA