
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 123843-66-3 |
| Catalog No. | 2A-9068775 |
| Chinese Name | 2,6-二氟对甲氧基苯腈 |
| Synonyms | 4-Cyano-3,5-difluoroanisole; NCR BF FF DO1; MFCD03094498; 2,6-Difluoro-4-methoxybenzonitrile |
| Molecular Formula | C8H5F2NO |
| Molecular Weight | 169.128 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 211.7±35.0 °C at 760 mmHg |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| HTC | 2926909090 |
| SMILES | COc1cc(F)c(C#N)c(F)c1 |
| InChI | InChI=1S/C8H5F2NO/c1-12-5-2-7(9)6(4-11)8(10)3-5/h2-3H,1H3 |
| InChI Key | CMGFDVIQHBAJHT-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,6-Difluoro-4-methoxyaniline | 151414-47-0 | 2A-9068767 |
| 8-Methoxy-3,4-dihydronaphthalen-1(2H)-one | 13185-18-7 | 2A-9068769 |
| 3-bromo-2-chlorobenzonitrile | 914250-82-1 | 2A-9068770 |
| 1-Methyl-D-tryptophan | 110117-83-4 | 2A-9068772 |
| 3-bromo-2-ethylbenzonitrile | 1253790-62-3 | 2A-9068773 |
| 2,5-Dichlorobenzenesulfonylchloride | 5402-73-3 | 2A-9068776 |
| 2-(4-Hydroxy-3-methylphenyl)aceticacidmethylester | 64360-47-0 | 2A-9068780 |
| 3-bromo-2-methoxybenzonitrile | 874472-98-7 | 2A-9068781 |
| 3-Fluoro-2-nitroaniline | 567-63-5 | 2A-9068784 |
| methyl2-amino-3-(4-chlorophenyl)propanoate | 23434-96-0 | 2A-9068786 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA