
CAS Number142313-30-2
SynonymsMFCD00052490; 5-chloro-6-fluoro-2-mercaptobenzimidazole; 2H-Benzimidazole-2-thione,5-chloro-6-fluoro-1,3-dihydro; 5-chloro-6-fluoro-1H-benzoimidazole-2-thiol
Molecular FormulaC7H3ClN2O3S
Molecular Weight230.63
Purity98%
Density1.63 g/cm3
Boiling Point294ºC at 760 mmHg
Melting Point298ºC
AppearanceBeige to gray powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 142313-30-2 |
| Catalog No. | 2A-9006793 |
| Chinese Name | 5-氯-6-氟-1H-苯并[d]咪唑-2(3H)-硫酮 |
| Synonyms | MFCD00052490; 5-chloro-6-fluoro-2-mercaptobenzimidazole; 2H-Benzimidazole-2-thione,5-chloro-6-fluoro-1,3-dihydro; 5-chloro-6-fluoro-1H-benzoimidazole-2-thiol |
| Molecular Formula | C7H3ClN2O3S |
| Molecular Weight | 230.63 |
| Purity | 98 |
| Density | 1.63 g/cm3 |
| Boiling Point | 294ºC at 760 mmHg |
| Melting Point | 298ºC |
| Appearance | Beige to gray powder |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2933990090 |
| MDL Number | MFCD11502945 |
| SMILES | Fc1cc2[nH]c(=S)[nH]c2cc1Cl |
| InChI | InChI=1S/C7H4ClFN2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,(H2,10,11,12) |
| InChI Key | DQXCFZSRGLNXKW-UHFFFAOYSA-N |
| MSDS | msds/6793_1_142313_30_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 6-Chloro-2-(4-chlorophenyl)-4-quinoline carboxylic acid | 126088-20-8 | 2A-9006774 |
| 6-Chloro-2-mercaptobenzoxazole | 22876-20-6 | 2A-9006781 |
| 6-Chloro-4-hydroxy-8-methylquinoline-3-carboxylic ethyl ester | 228728-86-7 | 2A-9006789 |
| 6-Chloro-5-cyano-4-methoxy-2-methyl-3-nitropyridine | 2A-106791 | 2A-9006791 |
| 6-Chloro-5-fluorobenzimidazole | 175135-04-3 | 2A-9006792 |
| 6-Chloro-5-fluorobenzotriazole | 99803-85-7 | 2A-9006794 |
| 6-Chloro-5-fluoroindole | 122509-72-2 | 2A-9006795 |
| 6-Chlorochromanone | 37674-72-9 | 2A-9006798 |
| 6-Chloroindole | 17422-33-2 | 2A-9006805 |
| 6-Chloroindole-2-carboxylic acid | 16732-75-5 | 2A-9006806 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA