
CAS Number22876-20-6
Synonyms6-Chloro-benzooxazole-2-thiol; 6-Chloro-2-benzoxazolethiol; 6-chloro-1,3-benzoxazole-2-thiol; 2-Mercapto-6-chlorobenzoxazole; 6-Chlorobenzo[d]oxazole-2-thiol; MFCD00800495; 6-Chloro-2-mercaptobenzoxazole; EINECS 245-282-8; 6-chloro-2-thiobenzooxazole
Molecular FormulaC7H4ClNOS
Molecular Weight185.63100
Purity99%
Density1.2291g/ml(rough estimate)
Boiling Point288.9±42.0℃(Predicted)
Melting Point229-232 ℃
AppearanceYellow to beige crystalline powder or needles
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 22876-20-6 |
| Catalog No. | 2A-9006781 |
| Chinese Name | 6-氯苯并[d]恶唑-2(3H)-硫酮 |
| Synonyms | 6-Chloro-benzooxazole-2-thiol; 6-Chloro-2-benzoxazolethiol; 6-chloro-1,3-benzoxazole-2-thiol; 2-Mercapto-6-chlorobenzoxazole; 6-Chlorobenzo[d]oxazole-2-thiol; MFCD00800495; 6-Chloro-2-mercaptobenzoxazole; EINECS 245-282-8; 6-chloro-2-thiobenzooxazole |
| Molecular Formula | C7H4ClNOS |
| Molecular Weight | 185.63100 |
| Purity | 99 |
| Density | 1.2291g/ml(rough estimate) |
| Boiling Point | 288.9±42.0℃(Predicted) |
| Melting Point | 229-232 ℃ |
| Appearance | Yellow to beige crystalline powder or needles |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2934999090 |
| SMILES | S=c1[nH]c2ccc(Cl)cc2o1 |
| InChI | InChI=1S/C7H4ClNOS/c8-4-1-2-5-6(3-4)10-7(11)9-5/h1-3H,(H,9,11) |
| InChI Key | HAASPZUBSZGCKU-UHFFFAOYSA-N |
| MSDS | msds/6781_1_22876_20_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 6-Bromochromanone | 49660-57-3 | 2A-9006761 |
| 6-Bromoindole | 52415-29-9 | 2A-9006770 |
| 6-Bromoindole-2-carboxylic acid | 16732-65-3 | 2A-9006771 |
| 6-Bromooxindole | 99365-40-9 | 2A-9006773 |
| 6-Chloro-2-(4-chlorophenyl)-4-quinoline carboxylic acid | 126088-20-8 | 2A-9006774 |
| 6-Chloro-4-hydroxy-8-methylquinoline-3-carboxylic ethyl ester | 228728-86-7 | 2A-9006789 |
| 6-Chloro-5-cyano-4-methoxy-2-methyl-3-nitropyridine | 2A-106791 | 2A-9006791 |
| 6-Chloro-5-fluorobenzimidazole | 175135-04-3 | 2A-9006792 |
| 6-Chloro-5-fluorobenzimidazole-2-thiol | 142313-30-2 | 2A-9006793 |
| 6-Chloro-5-fluorobenzotriazole | 99803-85-7 | 2A-9006794 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA