CAS Number87-63-8
Synonyms6-Chloro-o-toluidine; 2-Amino-3-chlorotoluene; 1-amino-2-methyl-6-chlorobenzene; o-Toluidine,6-chloro; 6-chloro-ortho-toluidine; 6-Chloro-2-toluidine; 6-CHLORO-2-METHYLANILINE; MFCD00007679; Benzenamine,2-chloro-6-methyl; 2-methyl-6-chloroaniline; 1-Amino-2-chloro-6-methylbenzene; 3-Chloro-2-aminotoluene; EINECS 201-759-2; 2-Chloro-6-methylaniline; 2-Chloro-6-Methylaninile; 2-chloro-6-methyl-aniline; 2-chloro-6-methylbenzenamine
Molecular Formula5-(Cl)-2-(CH3)C6H3NH2
Molecular Weight141.60
Purity≥98.0 (GC)%
Density1.2±0.1 g/cm3
Boiling Point237 °C/1013 hPa
Melting Point22 °C
Appearancesolid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 87-63-8 |
| Catalog No. | 2A-9006782 |
| Chinese Name | 2-氯-6-甲基苯胺 |
| Synonyms | 6-Chloro-o-toluidine; 2-Amino-3-chlorotoluene; 1-amino-2-methyl-6-chlorobenzene; o-Toluidine,6-chloro; 6-chloro-ortho-toluidine; 6-Chloro-2-toluidine; 6-CHLORO-2-METHYLANILINE; MFCD00007679; Benzenamine,2-chloro-6-methyl; 2-methyl-6-chloroaniline; 1-Amino-2-chloro-6-methylbenzene; 3-Chloro-2-aminotoluene; EINECS 201-759-2; 2-Chloro-6-methylaniline; 2-Chloro-6-Methylaninile; 2-chloro-6-methyl-aniline; 2-chloro-6-methylbenzenamine |
| Molecular Formula | 5-(Cl)-2-(CH3)C6H3NH2 |
| Molecular Weight | 141.60 |
| Purity | ≥98.0 (GC) |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 237 °C/1013 hPa |
| Melting Point | 22 °C |
| Appearance | solid |
| Water Solubility | Immiscible |
| Storage Condition | This product is sealed and stored in a cool and dr |
| Packaging | III |
| HTC | 2942000000 |
| MDL Number | MFCD00007779 |
| SMILES | Clc1cc(c(cc1)C)N |
| InChI | 1S/C7H8ClN/c1-5-2-3-6(8)4-7(5)9/h2-4H,9H2,1H3 |
| InChI Key | WRZOMWDJOLIVQP-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352116 |
| Hazard Symbols | 6.1 |
| MSDS | msds/6782_1_87_63_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Item 1 Poisons. UN number: 3429 Official shipping name: Chlorotoluidine, liquid Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-Chloro-2,3,4,5-tetrafluorobenzoic acid | 1860-80-0 | 2A-9006775 |
| 6-Chloro-2-fluoro-3-methylbenzoic acid | 32890-90-7 | 2A-9006777 |
| 6-Chloro-2-fluoro-3-methylbenzoyl chloride | 261762-81-6 | 2A-9006778 |
| 6-Chloro-2-fluoro-3-methylbenzyl alcohol | 261762-84-9 | 2A-9006779 |
| 6-Chloro-2-hexanone | 10226-30-9 | 2A-9006780 |
| 6-Chloro-3-cyanochromone | 50743-20-9 | 2A-9006784 |
| 6-Chloro-3-formylchromone | 42248-31-7 | 2A-9006786 |
| 6-Chloro-3-methyluracil | 4318-56-3 | 2A-9006787 |
| 6-Chlorobenzoxazolone | 19932-84-4 | 2A-9006797 |
| 6-Chlorochromone | 33533-99-2 | 2A-9006799 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS