
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 32890-90-7 |
| Catalog No. | 2A-9006777 |
| Chinese Name | 6-氯-2-氟-3-甲基苯甲酸 |
| Synonyms | RARECHEM AL BE 0496; 6-Chloro-2-fluoro-m-toluic acid; MFCD01631369 |
| Molecular Formula | C8H6ClFO2 |
| Molecular Weight | 188.58300 |
| Purity | 97 |
| Density | 1.403g/cm3 |
| Boiling Point | 279.7ºC at 760mmHg |
| Melting Point | 135-136°C |
| Appearance | white powder |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2916399090 |
| SMILES | Cc1ccc(Cl)c(C(=O)O)c1F |
| InChI | InChI=1S/C8H6ClFO2/c1-4-2-3-5(9)6(7(4)10)8(11)12/h2-3H,1H3,(H,11,12) |
| InChI Key | HLQCBMOWEQKVBL-UHFFFAOYSA-N |
| MSDS | msds/6777_1_32890_90_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-Bromochromone | 51483-92-2 | 2A-9006762 |
| 6-Bromohexanoic acid ethyl ester | 25542-62-5 | 2A-9006767 |
| 6-Bromohexanoyl chloride | 22809-37-6 | 2A-9006768 |
| 6-Bromonicotinic acid | 6311-35-9 | 2A-9006772 |
| 6-Chloro-2,3,4,5-tetrafluorobenzoic acid | 1860-80-0 | 2A-9006775 |
| 6-Chloro-2-fluoro-3-methylbenzoyl chloride | 261762-81-6 | 2A-9006778 |
| 6-Chloro-2-fluoro-3-methylbenzyl alcohol | 261762-84-9 | 2A-9006779 |
| 6-Chloro-2-hexanone | 10226-30-9 | 2A-9006780 |
| 6-Chloro-2-methylaniline | 87-63-8 | 2A-9006782 |
| 6-Chloro-3-cyanochromone | 50743-20-9 | 2A-9006784 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA