CAS Number320-98-9
Synonyms5-fluoro-2-nitro-benzoic acid; 5-fluoro-2-nitorobenzoic acid; 5-Fluor-2-nitro-benzoesaeure; 2-Carboxy-4-fluoronitrobenzene; 5-Fluoro-2-nitrobenzoic acid; 2-Nitro-5-fluorobenzoic acid; 3-fluoro-6-nitrobenzoic acid; BENZOIC ACID,5-FLUORO-2-NITRO; MFCD00055635
Molecular FormulaC7H3O4N1Cl1F1
Molecular Weight185.109
Purity98%
Density1.6±0.1 g/cm3
Boiling Point344.2±27.0 °C at 760 mmHg
Melting Point131-134 °C(lit.)
AppearanceWhite to light yellow crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 320-98-9 |
| Catalog No. | 2A-9006534 |
| Chinese Name | 2-硝基-5-氟苯甲酸 |
| Synonyms | 5-fluoro-2-nitro-benzoic acid; 5-fluoro-2-nitorobenzoic acid; 5-Fluor-2-nitro-benzoesaeure; 2-Carboxy-4-fluoronitrobenzene; 5-Fluoro-2-nitrobenzoic acid; 2-Nitro-5-fluorobenzoic acid; 3-fluoro-6-nitrobenzoic acid; BENZOIC ACID,5-FLUORO-2-NITRO; MFCD00055635 |
| Molecular Formula | C7H3O4N1Cl1F1 |
| Molecular Weight | 185.109 |
| Purity | 98 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 344.2±27.0 °C at 760 mmHg |
| Melting Point | 131-134 °C(lit.) |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Room Temperature |
| HTC | 2916399090 |
| MDL Number | MFCD12173034 |
| SMILES | Fc1c(cc(cc1C(=O)O)Cl)[N+](=O)[O-] |
| InChI | 1S/C7H3ClFNO4/c8-3-1-4(7(11)12)6(9)5(2-3)10(13)14/h1-2H,(H,11,12) |
| InChI Key | FFLWLOLRLIMBGA-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352100 |
| MSDS | msds/6534_1_320_98_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 5-Fluoro-2-nitrobenzoic acid Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Fluoro-2-methylbenzoic acid | 33184-16-6 | 2A-9006527 |
| 5-Fluoro-2-methylbenzonitrile | 77532-79-7 | 2A-9006528 |
| 5-Fluoro-2-methylphenol | 452-85-7 | 2A-9006530 |
| 5-Fluoro-2-methylphenylhydrazine hydrochloride | 325-50-8 | 2A-9006531 |
| 5-Fluoro-2-nitroaniline | 2369-11-1 | 2A-9006532 |
| 5-Fluoro-2-nitrobenzotrifluoride | 393-09-9 | 2A-9006535 |
| 5-Fluoro-2-nitrophenol | 446-36-6 | 2A-9006536 |
| 5-Fluoro-3-nitroaniline | 2369-12-2 | 2A-9006539 |
| 5-Fluorocytosine | 2022-85-7 | 2A-9006542 |
| 5-Fluoroisatin | 443-69-6 | 2A-9006545 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS