
CAS Number452-85-7
SynonymsQR CF F1; 5-fluoro-2-methyl-phenol; 5-Fluor-2-methyl-phenol; MFCD00673009; 5-Fluoro-2-methylphenol; 5-fluoranyl-2-methyl-phenol; 2-methyl-5-fluorophenol; 4-Fluoro-2-hydroxytoluene; 5-Fluoro-o-cresol
Molecular FormulaC7H7FO
Molecular Weight126.128
Purity98%
Density1.2±0.1 g/cm3
Boiling Point188.7±20.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 452-85-7 |
| Catalog No. | 2A-9006530 |
| Chinese Name | 5-氟-2-甲基苯酚 |
| Synonyms | QR CF F1; 5-fluoro-2-methyl-phenol; 5-Fluor-2-methyl-phenol; MFCD00673009; 5-Fluoro-2-methylphenol; 5-fluoranyl-2-methyl-phenol; 2-methyl-5-fluorophenol; 4-Fluoro-2-hydroxytoluene; 5-Fluoro-o-cresol |
| Molecular Formula | C7H7FO |
| Molecular Weight | 126.128 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 188.7±20.0 °C at 760 mmHg |
| Storage Condition | Store in a sealed container in a ventilated and dr |
| HTC | 2908199090 |
| SMILES | Cc1ccc(F)cc1O |
| InChI | InChI=1S/C7H7FO/c1-5-2-3-6(8)4-7(5)9/h2-4,9H,1H3 |
| InChI Key | CKJOSIHYVLHIER-UHFFFAOYSA-N |
| MSDS | msds/6530_1_452_85_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Fluoro-2-iodoaniline | 255724-71-1 | 2A-9006521 |
| 5-Fluoro-2-iodobenzonitrile | 2A-106522 | 2A-9006522 |
| 5-Fluoro-2-methoxy-3H-pyrimidin-4-one | 1480-96-2 | 2A-9006524 |
| 5-Fluoro-2-methylbenzoic acid | 33184-16-6 | 2A-9006527 |
| 5-Fluoro-2-methylbenzonitrile | 77532-79-7 | 2A-9006528 |
| 5-Fluoro-2-methylphenylhydrazine hydrochloride | 325-50-8 | 2A-9006531 |
| 5-Fluoro-2-nitroaniline | 2369-11-1 | 2A-9006532 |
| 5-Fluoro-2-nitrobenzoic acid | 320-98-9 | 2A-9006534 |
| 5-Fluoro-2-nitrobenzotrifluoride | 393-09-9 | 2A-9006535 |
| 5-Fluoro-2-nitrophenol | 446-36-6 | 2A-9006536 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA