
CAS Number4163-60-4
Synonymsβ-D-Galactose pentaacetate (VAN); Pentaacetyl β-D- galactose; D-Galactose Pentaacetate; beta-D-Galactose Pentaacetate; B-D-GALACTOSE PENTAACETATE; β-D-Galactose pentaacetate; EINECS 224-008-0; MFCD00063259
Molecular FormulaC16H22O11
Molecular Weight390.34
Purity98%
Density1.3±0.1 g/cm3
Boiling Point434.8±45.0 °C at 760 mmHg
Melting Point143-144 °C (lit.)
Appearancepowder
EINECS224-008-0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4163-60-4 |
| Catalog No. | 2A-9000647 |
| Chinese Name | β-D-半乳糖五乙酸酯 |
| Synonyms | β-D-Galactose pentaacetate (VAN); Pentaacetyl β-D- galactose; D-Galactose Pentaacetate; beta-D-Galactose Pentaacetate; B-D-GALACTOSE PENTAACETATE; β-D-Galactose pentaacetate; EINECS 224-008-0; MFCD00063259 |
| Molecular Formula | C16H22O11 |
| Molecular Weight | 390.34 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 434.8±45.0 °C at 760 mmHg |
| Melting Point | 143-144 °C (lit.) |
| Appearance | powder |
| Storage Condition | -20℃ Avoid light, ventilated and dry place, sealed |
| EINECS | 224-008-0 |
| HTC | 2942000000 |
| PubChem ID | 24848130 |
| MDL Number | MFCD00063259 |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | 1S/C16H22O11/c1-7(17)22-6-12-13(23-8(2)18)14(24-9(3)19)15(25-10(4)20)16(27-12)26-11(5)21/h12-16H,6H2,1-5H3/t12-,13+,14+,15-,16-/m1/s1 |
| InChI Key | LPTITAGPBXDDGR-LYYZXLFJSA-N |
| Beilstein/REAXYS | 98853 |
| NACRES Code | NA.22 |
| UNSPSC | 12352201 |
| Safety Description | S24/25 |
| MSDS | msds/647_1_4163_60_4.pdf |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,1-Diphenylethyl cyanide | 5558-67-8 | 2A-9000642 |
| 1,1-Diphenylethylene oxide | 882-59-7 | 2A-9000643 |
| 1,1-Diphenylhydrazine hydrochloride | 530-47-2 | 2A-9000644 |
| 1,2,2,6,6-Pentamethyl-4-piperidinol | 2403-89-6 | 2A-9000645 |
| 1,2,3,4,5,6,7,8-Octahydroacridine | 1658-08-8 | 2A-9000646 |
| 1,2,3,4-Tetrafluorobenzene | 551-62-2 | 2A-9000648 |
| 1,2,3,4-Tetrahydro-1-naphthoic acid | 1914-65-4 | 2A-9000649 |
| 1,2,3,5-Tetrafluorobenzene | 2367-82-0 | 2A-9000653 |
| 1,2,3-Trifluorobenzene | 1489-53-8 | 2A-9000662 |
| 1,2,3-trimethylbenzene | 526-73-8 | 2A-9000663 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA